1-(4-methoxyphenyl)-2,2-dimethylbutane-1,3-dione
Modify Date: 2025-10-02 11:57:59
1-(4-methoxyphenyl)-2,2-dimethylbutane-1,3-dione structure
|
Common Name | 1-(4-methoxyphenyl)-2,2-dimethylbutane-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 100612-50-8 | Molecular Weight | 220.26400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(4-methoxyphenyl)-2,2-dimethylbutane-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H16O3 |
|---|---|
| Molecular Weight | 220.26400 |
| Exact Mass | 220.11000 |
| PSA | 43.37000 |
| LogP | 2.49310 |
| InChIKey | DFEUKLAQUXACEA-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)C(C)(C)C(C)=O)cc1 |
|
~%
1-(4-methoxyphe... CAS#:100612-50-8 |
| Literature: Davis, Brian R.; Hinds, Mark G.; Ting, Philip P. C. Australian Journal of Chemistry, 1992 , vol. 45, # 5 p. 865 - 875 |
|
~%
1-(4-methoxyphe... CAS#:100612-50-8 |
| Literature: Bromham; Pinder Journal of the Chemical Society, 1959 , p. 2688,2693 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1-(4-methoxy-phenyl)-2,2-dimethyl-butane-1,3-dione |
| 1-(4-Methoxy-phenyl)-2,2-dimethyl-butan-1,3-dion |
| 1,3-Butanedione,1-(4-methoxyphenyl)-2,2-dimethyl |
| 1-(p-methoxyphenyl)-2,2-dimethylbutane-1,3-dione |