1-(4-methoxyphenyl)-3-(2,4,6-trimethylphenyl)propane-1,3-dione
Modify Date: 2025-11-26 08:11:32
1-(4-methoxyphenyl)-3-(2,4,6-trimethylphenyl)propane-1,3-dione structure
|
Common Name | 1-(4-methoxyphenyl)-3-(2,4,6-trimethylphenyl)propane-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 142472-14-8 | Molecular Weight | 296.36000 | |
| Density | 1.098g/cm3 | Boiling Point | 472.4ºC at 760mmHg | |
| Molecular Formula | C19H20O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 208.5ºC | |
| Name | 1-(4-methoxyphenyl)-3-(2,4,6-trimethylphenyl)propane-1,3-dione |
|---|
| Density | 1.098g/cm3 |
|---|---|
| Boiling Point | 472.4ºC at 760mmHg |
| Molecular Formula | C19H20O3 |
| Molecular Weight | 296.36000 |
| Flash Point | 208.5ºC |
| Exact Mass | 296.14100 |
| PSA | 43.37000 |
| LogP | 4.07610 |
| Vapour Pressure | 4.29E-09mmHg at 25°C |
| Index of Refraction | 1.558 |
| InChIKey | LVUWQLFMHIZAEJ-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)CC(=O)c2c(C)cc(C)cc2C)cc1 |
|
~12%
1-(4-methoxyphe... CAS#:142472-14-8 |
| Literature: Choshi; horimoto; Wang; Nagase; Ichikawa; Sugino; Hibino Chemical and Pharmaceutical Bulletin, 1992 , vol. 40, # 4 p. 1047 - 1049 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |