| Name | 3-Chloro-N-(3-chlorophenyl)propanamide |
|---|---|
| Synonyms |
Propanamide,N-(3-chlorophenyl)-3-chloro
3-Chlor-propionsaeure-(3-chlor-anilid) 3-chloro-propionic acid-(3-chloro-anilide) |
| Density | 1.343 g/cm3 |
|---|---|
| Boiling Point | 384.5ºC at 760 mmHg |
| Molecular Formula | C9H9Cl2NO |
| Molecular Weight | 218.08000 |
| Exact Mass | 217.00600 |
| PSA | 29.10000 |
| LogP | 2.98040 |
| Index of Refraction | 1.591 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2924299090 |
|
~74%
99585-98-5 |
| Literature: Perrone; Berardi; Leopoldo; Tortorella; Lograno; Daniele; Govoni Farmaco, 1995 , vol. 50, # 7-8 p. 505 - 510 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |