5-Phenylthiophene-2-sulfonyl chloride structure
|
Common Name | 5-Phenylthiophene-2-sulfonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 97272-02-1 | Molecular Weight | 258.74400 | |
| Density | 1.43g/cm3 | Boiling Point | 397.4ºC at 760mmHg | |
| Molecular Formula | C10H7ClO2S2 | Melting Point | 85-87ºC | |
| MSDS | USA | Flash Point | 194.1ºC | |
| Name | 5-Phenylthiophene-2-sulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.43g/cm3 |
|---|---|
| Boiling Point | 397.4ºC at 760mmHg |
| Melting Point | 85-87ºC |
| Molecular Formula | C10H7ClO2S2 |
| Molecular Weight | 258.74400 |
| Flash Point | 194.1ºC |
| Exact Mass | 257.95800 |
| PSA | 70.76000 |
| LogP | 4.42340 |
| Index of Refraction | 1.616 |
| InChIKey | NHRKTBLHJKMFTP-UHFFFAOYSA-N |
| SMILES | O=S(=O)(Cl)c1ccc(-c2ccccc2)s1 |
| Hazard Codes | C: Corrosive; |
|---|---|
| HS Code | 2934999090 |
|
~79%
5-Phenylthiophe... CAS#:97272-02-1 |
| Literature: Texas Biotechnology Corp. Patent: US6342610 B2, 2002 ; Location in patent: Page column 107 ; US 6342610 B2 |
|
~42%
5-Phenylthiophe... CAS#:97272-02-1 |
| Literature: Bulletin of the Chemical Society of Japan, , vol. 58, # 3 p. 1063 - 1064 |
|
~%
5-Phenylthiophe... CAS#:97272-02-1 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 6, # 22 p. 2651 - 2656 |
|
~%
5-Phenylthiophe... CAS#:97272-02-1 |
| Literature: Bulletin of the Chemical Society of Japan, , vol. 58, # 3 p. 1063 - 1064 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-Phenylthiophene-2-sulphonyl chloride |
| 5-phenyl-thiophene-2-sulfonyl chloride |
| 5-Phenyl-2-thiophenesulfonyl chloride |
| 5-phenyl-2-thiophenesulphonyl chloride |