5-Chloronaphthalene-2-sulfonyl Chloride
Modify Date: 2025-08-25 19:23:34
5-Chloronaphthalene-2-sulfonyl Chloride structure
|
Common Name | 5-Chloronaphthalene-2-sulfonyl Chloride | ||
|---|---|---|---|---|
| CAS Number | 89108-45-2 | Molecular Weight | 261.12400 | |
| Density | 1.516g/cm3 | Boiling Point | 402.9ºC at 760 mmHg | |
| Molecular Formula | C10H6Cl2O2S | Melting Point | 110-112ºC | |
| MSDS | USA | Flash Point | 197.5ºC | |
| Name | 5-Chloronaphthalene-2-sulfonyl Chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.516g/cm3 |
|---|---|
| Boiling Point | 402.9ºC at 760 mmHg |
| Melting Point | 110-112ºC |
| Molecular Formula | C10H6Cl2O2S |
| Molecular Weight | 261.12400 |
| Flash Point | 197.5ºC |
| Exact Mass | 259.94700 |
| PSA | 42.52000 |
| LogP | 4.50150 |
| Index of Refraction | 1.649 |
| InChIKey | MICVPVPQQNFKGU-UHFFFAOYSA-N |
| SMILES | O=S(=O)(Cl)c1ccc2c(Cl)cccc2c1 |
| HS Code | 2904909090 |
|---|
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 5-Chloro-2-naphthalenesulfonylchloride |
| 5-chloronaphthalene-2-sulphonyl chloride |
| 6-(chloronaphthalen-2-yl)sulfonyl chloride |
| OR7150T |
| 2-Naphthalenesulfonylchloride,5-chloro |
| 5-chloro-naphthalene-2-sulfonyl chloride |
| 5-Chlor-naphthalin-2-sulfonylchlorid |