safflor yellow B
Modify Date: 2024-04-04 16:00:07
safflor yellow B structure
|
Common Name | safflor yellow B | ||
|---|---|---|---|---|
| CAS Number | 91574-92-4 | Molecular Weight | 1062.93000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C48H54O27 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of safflor yellow BSafflor yellow B suppresses angiotensin II-mediated human umbilical vein cell injury via regulation of Bcl-2/p22(phox) expression. Safflor yellow B exhibits neuroprotective effects[1]. |
| Name | safflor yellow B |
|---|
| Description | Safflor yellow B suppresses angiotensin II-mediated human umbilical vein cell injury via regulation of Bcl-2/p22(phox) expression. Safflor yellow B exhibits neuroprotective effects[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C48H54O27 |
|---|---|
| Molecular Weight | 1062.93000 |
| Exact Mass | 1062.29000 |
| PSA | 511.57000 |
| InChIKey | STJDRLLBELOEQZ-UHFFFAOYSA-N |
| SMILES | O=C1C(=C(O)C=Cc2ccc(O)cc2)C(O)=C(C(C2=C(O)C(=C(O)C=Cc3ccc(O)cc3)C(=O)C(O)(C3OC(CO)C(O)C(O)C3O)C2=O)C(O)C(O)C(O)C(O)CO)C(=O)C1(O)C1OC(CO)C(O)C(O)C1O |