3’-O-(t-Butyldiphenylsilyl) thymidine structure
|
Common Name | 3’-O-(t-Butyldiphenylsilyl) thymidine | ||
|---|---|---|---|---|
| CAS Number | 83467-48-5 | Molecular Weight | 320.10 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H13DTBN2O5PS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 3’-O-(t-Butyldiphenylsilyl) thymidine3’-O-(t-Butyldiphenylsilyl) thymidine is a purine nucleoside analog. Purine nucleoside analogs have broad antitumor activity targeting indolent lymphoid malignancies. Anticancer mechanisms in this process rely on inhibition of DNA synthesis, induction of apoptosis, etc[1]. |
| Name | 2'-Deoxy-3'-O-[(2-methyl-2-propanyl)(diphenyl)silyl]-3,4-dihydrot hymidine |
|---|---|
| Synonym | More Synonyms |
| Description | 3’-O-(t-Butyldiphenylsilyl) thymidine is a purine nucleoside analog. Purine nucleoside analogs have broad antitumor activity targeting indolent lymphoid malignancies. Anticancer mechanisms in this process rely on inhibition of DNA synthesis, induction of apoptosis, etc[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C10H13DTBN2O5PS |
|---|---|
| Molecular Weight | 320.10 |
| Exact Mass | 480.20800 |
| PSA | 93.81000 |
| LogP | 2.48230 |
| InChIKey | KYIOWQKIGDBICI-KMWPLCEJSA-N |
| SMILES | CC1CN(C2CC(O[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)C(CO)O2)C(=O)NC1=O |
| Precursor 8 | |
|---|---|
| DownStream 1 | |
| 2'-deoxy-3'-tert-butyldiphenylsilyl-thymidine |
| 3'-O-(t-butyldiphenylsilyl)thymidine |
| 3'-O-(tert-butyldimethylsilyl)adenosine |
| 3'-O-tert-butyldiphenylsilyl-2'-deoxythymidine |
| O3'-(tert-butyl-dimethyl-silanyl)-adenosine |
| 3'-O-(tert-butyldiphenylsilyl)thymidine |
| 1-[(2R,4S,5R)-4-(tert-butyldiphenylsilanyloxy)-5-hydroxymethyltetrahydrofuran-2-yl]-5-methyl-1H-pyrimidine-2,4-dione |
| 3'-O-TBDPS-thymidine |