2,3-bis(diethylamino)-N-(4-methoxy-2-methylphenyl)propanamide
Modify Date: 2024-04-13 20:19:50
2,3-bis(diethylamino)-N-(4-methoxy-2-methylphenyl)propanamide structure
|
Common Name | 2,3-bis(diethylamino)-N-(4-methoxy-2-methylphenyl)propanamide | ||
|---|---|---|---|---|
| CAS Number | 78406-78-7 | Molecular Weight | 335.48400 | |
| Density | 1.028g/cm3 | Boiling Point | 460.8ºC at 760 mmHg | |
| Molecular Formula | C19H33N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 232.5ºC | |
| Name | 2,3-bis(diethylamino)-N-(4-methoxy-2-methylphenyl)propanamide |
|---|
| Density | 1.028g/cm3 |
|---|---|
| Boiling Point | 460.8ºC at 760 mmHg |
| Molecular Formula | C19H33N3O2 |
| Molecular Weight | 335.48400 |
| Flash Point | 232.5ºC |
| Exact Mass | 335.25700 |
| PSA | 44.81000 |
| LogP | 3.06730 |
| Index of Refraction | 1.532 |
| InChIKey | OWHOKOIENJOGPI-UHFFFAOYSA-N |
| SMILES | CCN(CC)CC(C(=O)Nc1ccc(OC)cc1C)N(CC)CC |
|
~51%
2,3-bis(diethyl... CAS#:78406-78-7 |
| Literature: Tenthorey, Paul A.; Adams, H. Jack; Kronberg, George H.; Takman, Bertil H. Journal of Medicinal Chemistry, 1981 , vol. 24, # 9 p. 1059 - 1063 |
|
~%
2,3-bis(diethyl... CAS#:78406-78-7 |
| Literature: Tenthorey, Paul A.; Adams, H. Jack; Kronberg, George H.; Takman, Bertil H. Journal of Medicinal Chemistry, 1981 , vol. 24, # 9 p. 1059 - 1063 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |