2-methyl-N-[2-[4-(2-methylbenzoyl)piperazin-1-yl]ethyl]benzamide structure
|
Common Name | 2-methyl-N-[2-[4-(2-methylbenzoyl)piperazin-1-yl]ethyl]benzamide | ||
|---|---|---|---|---|
| CAS Number | 6374-84-1 | Molecular Weight | 365.46900 | |
| Density | 1.14g/cm3 | Boiling Point | 581.9ºC at 760mmHg | |
| Molecular Formula | C22H27N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 305.7ºC | |
| Name | 2-methyl-N-[2-[4-(2-methylbenzoyl)piperazin-1-yl]ethyl]benzamide |
|---|
| Density | 1.14g/cm3 |
|---|---|
| Boiling Point | 581.9ºC at 760mmHg |
| Molecular Formula | C22H27N3O2 |
| Molecular Weight | 365.46900 |
| Flash Point | 305.7ºC |
| Exact Mass | 365.21000 |
| PSA | 56.14000 |
| LogP | 2.94180 |
| Index of Refraction | 1.584 |
| InChIKey | MZVFDTIYUFIGJT-UHFFFAOYSA-N |
| SMILES | Cc1ccccc1C(=O)NCCN1CCN(C(=O)c2ccccc2C)CC1 |
|
~%
2-methyl-N-[2-[... CAS#:6374-84-1 |
| Literature: Bayer and Co. Patent: DE288825 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 12, p. 414 |
|
~%
2-methyl-N-[2-[... CAS#:6374-84-1 |
| Literature: Chamberlin Synthetic Communications, 1995 , vol. 25, # 1 p. 27 - 31 |
|
~%
2-methyl-N-[2-[... CAS#:6374-84-1 |
| Literature: Bayer and Co. Patent: DE236604 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 10, p. 581 |
|
~%
2-methyl-N-[2-[... CAS#:6374-84-1 |
| Literature: Bayer and Co. Patent: DE236604 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 10, p. 581 |