7-(5,5-dimethylhex-1-en-3-yl)quinolin-8-ol
Modify Date: 2024-07-22 13:08:33
7-(5,5-dimethylhex-1-en-3-yl)quinolin-8-ol structure
|
Common Name | 7-(5,5-dimethylhex-1-en-3-yl)quinolin-8-ol | ||
|---|---|---|---|---|
| CAS Number | 62189-90-6 | Molecular Weight | 255.35500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H21NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 7-(5,5-dimethylhex-1-en-3-yl)quinolin-8-ol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H21NO |
|---|---|
| Molecular Weight | 255.35500 |
| Exact Mass | 255.16200 |
| PSA | 33.12000 |
| LogP | 4.64620 |
| InChIKey | KFTMHZQMEBYSFX-UHFFFAOYSA-N |
| SMILES | C=CC(CC(C)(C)C)c1ccc2cccnc2c1O |
|
~%
7-(5,5-dimethyl... CAS#:62189-90-6 |
| Literature: Cerny, Mirko; Vilimec, Jan; Stastova, Jitka; Rod, Vladimir; Kraus, Milos Collection of Czechoslovak Chemical Communications, 1989 , vol. 54, # 4 p. 922 - 933 |
|
~%
7-(5,5-dimethyl... CAS#:62189-90-6 |
| Literature: Cerny, Mirko; Vilimec, Jan; Stastova, Jitka; Rod, Vladimir; Kraus, Milos Collection of Czechoslovak Chemical Communications, 1989 , vol. 54, # 4 p. 922 - 933 |
| 8-Quinolinol,7-(1-ethenyl-3,3-dimethylbutyl) |
| 8-Hydroxy-7-(1-vinyl-3,3-dimethyl-butyl)-chinolin |
| 7-(1-ethenyl-3,3-dimethylbutyl)-8-quinolinol |
| 7-[1-(2,2-dimethyl-propyl)-allyl]-quinolin-8-ol |