7-(3,3,5,5-tetramethyl-1-vinylhexyl)quinolin-8-ol structure
|
Common Name | 7-(3,3,5,5-tetramethyl-1-vinylhexyl)quinolin-8-ol | ||
|---|---|---|---|---|
| CAS Number | 29171-27-5 | Molecular Weight | 311.46100 | |
| Density | 1.007g/cm3 | Boiling Point | 428.8ºC at 760mmHg | |
| Molecular Formula | C21H29NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213.1ºC | |
| Name | 7-(5,5,7,7-tetramethyloct-1-en-3-yl)quinolin-8-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.007g/cm3 |
|---|---|
| Boiling Point | 428.8ºC at 760mmHg |
| Molecular Formula | C21H29NO |
| Molecular Weight | 311.46100 |
| Flash Point | 213.1ºC |
| Exact Mass | 311.22500 |
| PSA | 33.12000 |
| LogP | 6.06250 |
| Vapour Pressure | 5.89E-08mmHg at 25°C |
| Index of Refraction | 1.557 |
| InChIKey | VOHHCUUIBNXCNP-UHFFFAOYSA-N |
| SMILES | C=CC(CC(C)(C)CC(C)(C)C)c1ccc2cccnc2c1O |
| HS Code | 2933499090 |
|---|
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| einecs 249-486-8 |