5-[(3,4-dimethoxyphenyl)methyl]-1,3-diazinane-2,4,6-trione structure
|
Common Name | 5-[(3,4-dimethoxyphenyl)methyl]-1,3-diazinane-2,4,6-trione | ||
|---|---|---|---|---|
| CAS Number | 57737-42-5 | Molecular Weight | 278.26100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H14N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-[(3,4-dimethoxyphenyl)methyl]-1,3-diazinane-2,4,6-trione |
|---|
| Molecular Formula | C13H14N2O5 |
|---|---|
| Molecular Weight | 278.26100 |
| Exact Mass | 278.09000 |
| PSA | 100.71000 |
| LogP | 0.78030 |
| InChIKey | JRFQBCPZBQLZJO-UHFFFAOYSA-N |
| SMILES | COc1ccc(CC2C(=O)NC(=O)NC2=O)cc1OC |
|
~75%
5-[(3,4-dimetho... CAS#:57737-42-5 |
| Literature: Tzeng, Cherng-Chyi; Panzica, Raymond P.; Naguib, Fardos N.M.; Kouni, Mahmoud H. el Journal of Heterocyclic Chemistry, 1993 , vol. 30, # 5 p. 1399 - 1404 |
|
~%
5-[(3,4-dimetho... CAS#:57737-42-5 |
| Literature: Tzeng, Cherng-Chyi; Panzica, Raymond P.; Naguib, Fardos N.M.; Kouni, Mahmoud H. el Journal of Heterocyclic Chemistry, 1993 , vol. 30, # 5 p. 1399 - 1404 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |