5-[(3,4-dimethoxyphenyl)methylidene]-1,3-diazinane-2,4,6-trione
Modify Date: 2025-11-26 06:56:48
![5-[(3,4-dimethoxyphenyl)methylidene]-1,3-diazinane-2,4,6-trione Structure](https://image.chemsrc.com/caspic/028/66386-22-9.png)
5-[(3,4-dimethoxyphenyl)methylidene]-1,3-diazinane-2,4,6-trione structure
|
Common Name | 5-[(3,4-dimethoxyphenyl)methylidene]-1,3-diazinane-2,4,6-trione | ||
|---|---|---|---|---|
| CAS Number | 66386-22-9 | Molecular Weight | 276.24500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H12N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-[(3,4-dimethoxyphenyl)methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H12N2O5 |
|---|---|
| Molecular Weight | 276.24500 |
| Exact Mass | 276.07500 |
| PSA | 93.73000 |
| LogP | 1.11080 |
| InChIKey | ISWHPQMMRBTZOY-UHFFFAOYSA-N |
| SMILES | COc1ccc(C=C2C(=O)NC(=O)NC2=O)cc1OC |
| HS Code | 2933540000 |
|---|
|
~99%
5-[(3,4-dimetho... CAS#:66386-22-9 |
| Literature: Tzeng, Cherng-Chyi; Panzica, Raymond P.; Naguib, Fardos N.M.; Kouni, Mahmoud H. el Journal of Heterocyclic Chemistry, 1993 , vol. 30, # 5 p. 1399 - 1404 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
![5-[(3,4-dimethoxyphenyl)methyl]-1,3-diazinane-2,4,6-trione structure](https://image.chemsrc.com/caspic/438/57737-42-5.png)
CAS#:57737-42-5| HS Code | 2933540000 |
|---|---|
| Summary | 2933540000 other derivatives of malonylurea (barbituric acid); salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| 5-Veratryliden-barbitursaeure |
| 5-veratrylidene-barbituric acid |