5-Formylindole-CE phosphoramidite structure
|
Common Name | 5-Formylindole-CE phosphoramidite | ||
|---|---|---|---|---|
| CAS Number | 460355-05-9 | Molecular Weight | 763.86 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C44H50N3O7P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 5-Formylindole-CE phosphoramidite5-Formylindole-CE phosphoramidite is a phosphorite monomer that can be used in the synthesis of oligonucleotides. |
| Name | 5-Formylindole-CE phosphoramidite |
|---|
| Description | 5-Formylindole-CE phosphoramidite is a phosphorite monomer that can be used in the synthesis of oligonucleotides. |
|---|---|
| Related Catalog |
| Molecular Formula | C44H50N3O7P |
|---|---|
| Molecular Weight | 763.86 |
| InChIKey | AJFOLTOXFRVENP-ARCMRJPPSA-N |
| SMILES | COc1ccc(C(OCC2OC(n3cc(C=O)c4ccccc43)CC2OP(OCCC#N)N(C(C)C)C(C)C)(c2ccccc2)c2ccc(OC)cc2)cc1 |