Methyl (3R)-(-)-3-(1-methylindol-3-yl)butanoate structure
|
Common Name | Methyl (3R)-(-)-3-(1-methylindol-3-yl)butanoate | ||
|---|---|---|---|---|
| CAS Number | 460050-72-0 | Molecular Weight | 231.29 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 350.4±17.0 °C at 760 mmHg | |
| Molecular Formula | C14H17NO2 | Melting Point | N/A | |
| MSDS | Chinese | Flash Point | 165.7±20.9 °C | |
| Symbol |
GHS05, GHS07 |
Signal Word | Danger | |
| Name | Methyl (3R)-(-)-3-(1-methylindol-3-yl)butanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 350.4±17.0 °C at 760 mmHg |
| Molecular Formula | C14H17NO2 |
| Molecular Weight | 231.29 |
| Flash Point | 165.7±20.9 °C |
| Exact Mass | 231.125931 |
| LogP | 2.93 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.548 |
| InChIKey | QIOUBQLAFUPETC-SNVBAGLBSA-N |
| SMILES | COC(=O)CC(C)c1cn(C)c2ccccc12 |
| Symbol |
GHS05, GHS07 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H302-H315-H317-H318-H335 |
| Precautionary Statements | P261-P280-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| Methyl (3R)-3-(1-methyl-1H-indol-3-yl)butanoate |
| 1H-Indole-3-propanoic acid, β,1-dimethyl-, methyl ester, (βR)- |
| METHYL (3R)-(-)-3-(1-METHYLINDOL-3-YL)BUTANOATE |
| MFCD05664283 |