1-[4-(dimethylamino)phenyl]-2-methylpropan-1-one structure
|
Common Name | 1-[4-(dimethylamino)phenyl]-2-methylpropan-1-one | ||
|---|---|---|---|---|
| CAS Number | 4278-79-9 | Molecular Weight | 191.26900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H17NO | Melting Point | N/A | |
| MSDS | USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 1-[4-(dimethylamino)phenyl]-2-methylpropan-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H17NO |
|---|---|
| Molecular Weight | 191.26900 |
| Exact Mass | 191.13100 |
| PSA | 20.31000 |
| LogP | 2.59130 |
| InChIKey | PCCMMAUTWSOKRJ-UHFFFAOYSA-N |
| SMILES | CC(C)C(=O)c1ccc(N(C)C)cc1 |
| Precursor 10 | |
|---|---|
| DownStream 2 | |
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| p-N,N-Dimethylaminoisobutyrophenon |
| <p-Dimethylamino-phenyl>-isopropyl-keton |