1,1,1,2,3,3,3-heptafluoro-2-nitrosopropane structure
|
Common Name | 1,1,1,2,3,3,3-heptafluoro-2-nitrosopropane | ||
|---|---|---|---|---|
| CAS Number | 422-98-0 | Molecular Weight | 199.02700 | |
| Density | 1.66g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C3F7NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,1,1,2,3,3,3-heptafluoro-2-nitrosopropane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.66g/cm3 |
|---|---|
| Molecular Formula | C3F7NO |
| Molecular Weight | 199.02700 |
| Exact Mass | 198.98700 |
| PSA | 29.43000 |
| LogP | 2.54320 |
| Vapour Pressure | 3270mmHg at 25°C |
| Index of Refraction | 1.28 |
| InChIKey | WOJKTSOYJLOODF-UHFFFAOYSA-N |
| SMILES | O=NC(F)(C(F)(F)F)C(F)(F)F |
| Hazard Codes | T: Toxic; |
|---|---|
| HS Code | 2904909090 |
|
~%
1,1,1,2,3,3,3-h... CAS#:422-98-0 |
| Literature: Andreades,S. Journal of Organic Chemistry, 1962 , vol. 27, p. 4163 - 4170 |
|
~%
1,1,1,2,3,3,3-h... CAS#:422-98-0 |
| Literature: Banks, Ronald E.; Dickinson, Neil; Morrissey, Alan P.; Richards, Adrian Journal of Fluorine Chemistry, 1984 , vol. 26, p. 87 - 92 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Heptafluoro-2-nitrosopropane |
| PC4952 |
| 1,1,1,2,3,3,3-heptafluoro-2-nitroso-propane |
| 2-Nitroso-heptafluor-propan |
| i-heptafluoronitrosopropane |
| Heptafluor-2-nitrosopropan |
| 2-Nitrosoperfluoropropane |
| 1,1,1,2,3,3,3-Heptafluor-2-nitrosopropan |
| perfluoro-2-nitrosopropane |