Purple-β-D-Gal
Modify Date: 2024-10-14 09:44:26
Purple-β-D-Gal structure
|
Common Name | Purple-β-D-Gal | ||
|---|---|---|---|---|
| CAS Number | 36473-36-6 | Molecular Weight | 421.18400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H16INO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Purple-β-D-GalPurple-β-D-Gal is a chromogenic β-galactosidase substrate. Intracellular enzymatic hydrolysis of Purple-β-D-Gal generates free indoxyl molecules, which undergo in situ oxidation and subsequent dimerization to produce chromogenic, water-insoluble, indigo precipitates. Purple-β-D-Gal can be used for the detection of β-galactosidase activity[1]. |
| Name | 5-IODO-3-INDOLYL-β -D-GALACTOPYRANOSI |
|---|
| Description | Purple-β-D-Gal is a chromogenic β-galactosidase substrate. Intracellular enzymatic hydrolysis of Purple-β-D-Gal generates free indoxyl molecules, which undergo in situ oxidation and subsequent dimerization to produce chromogenic, water-insoluble, indigo precipitates. Purple-β-D-Gal can be used for the detection of β-galactosidase activity[1]. |
|---|---|
| Related Catalog | |
| Target |
β-galactosidase[1] |
| References |
| Molecular Formula | C14H16INO6 |
|---|---|
| Molecular Weight | 421.18400 |
| Exact Mass | 421.00200 |
| PSA | 115.17000 |
| InChIKey | XNKCQUZRJVDUFR-MBJXGIAVSA-N |
| SMILES | OCC1OC(Oc2c[nH]c3ccc(I)cc23)C(O)C(O)C1O |
| Safety Phrases | 22-24/25 |
|---|---|
| WGK Germany | 3 |