DGKα-IN-2 structure
|
Common Name | DGKα-IN-2 | ||
|---|---|---|---|---|
| CAS Number | 2648556-92-5 | Molecular Weight | 461.43 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H22F3N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of DGKα-IN-2DGKα-IN-2 (example 48) is a DGKα inhibitor with the IC50 of 0.9 nM, extracted from patent WO2021105115. DGKα-IN-2 significantly enhances the anti-tumor effect of anti-PD-1 by increasing the proliferation and function of T cells. DGKα-IN-2 has the potential for cancer and immunology study. |
| Name | DGKα-IN-2 |
|---|
| Description | DGKα-IN-2 (example 48) is a DGKα inhibitor with the IC50 of 0.9 nM, extracted from patent WO2021105115. DGKα-IN-2 significantly enhances the anti-tumor effect of anti-PD-1 by increasing the proliferation and function of T cells. DGKα-IN-2 has the potential for cancer and immunology study. |
|---|---|
| Related Catalog | |
| Target |
0.9 nM (DGKα) |
| References |
| Molecular Formula | C23H22F3N3O4 |
|---|---|
| Molecular Weight | 461.43 |
| InChIKey | AETHHGASMIIOSO-UHFFFAOYSA-N |
| SMILES | Cn1c(=O)c(C(N)=O)c(N2CCC(Oc3ccc(OC(F)(F)F)cc3)CC2)c2ccccc21 |