2'-Deoxyguanosine-13C10,15N5 monohydrate structure
|
Common Name | 2'-Deoxyguanosine-13C10,15N5 monohydrate | ||
|---|---|---|---|---|
| CAS Number | 2483830-26-6 | Molecular Weight | 300.15 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | 13C10H1515N5O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 2'-Deoxyguanosine-13C10,15N5 monohydrate2'-Deoxyguanosine-13C10,15N5 (monohydrate) is the 13C and 15N labeled 2'-Deoxyguanosine monohydrate[1]. 2'-Deoxyguanosine monohydrate is an endogenous metabolite. |
| Name | 2'-Deoxyguanosine-13C10,15N5 monohydrate |
|---|
| Description | 2'-Deoxyguanosine-13C10,15N5 (monohydrate) is the 13C and 15N labeled 2'-Deoxyguanosine monohydrate[1]. 2'-Deoxyguanosine monohydrate is an endogenous metabolite. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Molecular Formula | 13C10H1515N5O5 |
|---|---|
| Molecular Weight | 300.15 |
| InChIKey | LZSCQUCOIRGCEJ-DKCGKRJGSA-N |
| SMILES | Nc1nc2c(ncn2C2CC(O)C(CO)O2)c(=O)[nH]1.O |