2'-Deoxyadenosine monohydrate-13C10,15N5 hydrate structure
|
Common Name | 2'-Deoxyadenosine monohydrate-13C10,15N5 hydrate | ||
|---|---|---|---|---|
| CAS Number | 2483830-27-7 | Molecular Weight | 284.15 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | 13C10H1515N5O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 2'-Deoxyadenosine monohydrate-13C10,15N5 hydrate2'-Deoxyadenosine monohydrate-13C10,15N5 (hydrate) is the 13C and 15N labeled 2'-Deoxyadenosine monohydrate[1]. 2'-Deoxyadenosine monohydrate is a deoxyribonucleoside. A building block in the chemical synthesis. |
| Name | 2'-Deoxyadenosine monohydrate-13C10,15N5 hydrate |
|---|
| Description | 2'-Deoxyadenosine monohydrate-13C10,15N5 (hydrate) is the 13C and 15N labeled 2'-Deoxyadenosine monohydrate[1]. 2'-Deoxyadenosine monohydrate is a deoxyribonucleoside. A building block in the chemical synthesis. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Molecular Formula | 13C10H1515N5O4 |
|---|---|
| Molecular Weight | 284.15 |
| InChIKey | WZJWHIMNXWKNTO-JIFFDEGKSA-N |
| SMILES | Nc1ncnc2c1ncn2C1CC(O)C(CO)O1.O |