3',5'-di-O-acetyl-2'-O-methyl-6-chloro-2-aminopurine riboside structure
|
Common Name | 3',5'-di-O-acetyl-2'-O-methyl-6-chloro-2-aminopurine riboside | ||
|---|---|---|---|---|
| CAS Number | 244184-56-3 | Molecular Weight | 399.79 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H18ClN5O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 3',5'-di-O-acetyl-2'-O-methyl-6-chloro-2-aminopurine riboside3',5'-Di-O-acetyl-2'-O-methyl-6-chloro-2-aminopurine riboside is a purine nucleoside analog. Purine nucleoside analogs have broad antitumor activity targeting indolent lymphoid malignancies. Anticancer mechanisms in this process rely on inhibition of DNA synthesis, induction of apoptosis, etc[1]. |
| Name | 3',5'-di-O-acetyl-2'-O-methyl-6-chloro-2-aminopurine riboside |
|---|
| Description | 3',5'-Di-O-acetyl-2'-O-methyl-6-chloro-2-aminopurine riboside is a purine nucleoside analog. Purine nucleoside analogs have broad antitumor activity targeting indolent lymphoid malignancies. Anticancer mechanisms in this process rely on inhibition of DNA synthesis, induction of apoptosis, etc[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C15H18ClN5O6 |
|---|---|
| Molecular Weight | 399.79 |
| Exact Mass | 399.09500 |
| PSA | 140.68000 |
| LogP | 1.05030 |
| InChIKey | FAQUJDRYWBDRAM-IDTAVKCVSA-N |
| SMILES | COC1C(OC(C)=O)C(COC(C)=O)OC1n1cnc2c(Cl)nc(N)nc21 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |