NWP-0476 structure
|
Common Name | NWP-0476 | ||
|---|---|---|---|---|
| CAS Number | 2290611-26-4 | Molecular Weight | 925.49 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C47H53ClN8O8S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of NWP-0476NWP-0476 is BCL-2/BCL-xL inhibitor. NWP-0476 has a modified structure with fine-tuned BCL-xL activity. NWP-0476 can be used for relapsed T-acute lymphoblastic leukemia (T-ALL) research[1]. |
| Name | NWP-0476 |
|---|
| Description | NWP-0476 is BCL-2/BCL-xL inhibitor. NWP-0476 has a modified structure with fine-tuned BCL-xL activity. NWP-0476 can be used for relapsed T-acute lymphoblastic leukemia (T-ALL) research[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C47H53ClN8O8S |
|---|---|
| Molecular Weight | 925.49 |
| InChIKey | AICNKYZLGPRISR-PSXMRANNSA-N |
| SMILES | CC1(C)CCC(CN2CCN(c3ccc(C(=O)NS(=O)(=O)c4ccc(NCC5COCCO5)c([N+](=O)[O-])c4)c(N4CCCOc5nc6[nH]ccc6cc54)c3)CC2)=C(c2ccc(Cl)cc2)C1 |