Synstatin (92-119)
Modify Date: 2025-08-27 09:44:55
Synstatin (92-119) structure
|
Common Name | Synstatin (92-119) | ||
|---|---|---|---|---|
| CAS Number | 1259384-47-8 | Molecular Weight | 3032.27 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C133H207N35O46 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Synstatin (92-119)Synstatin (92-119) is an anti-tumor agent that inhibits angiogenesis and cancer cell invasion. Synstatin (92-119) down-regulates integrin α?β3 and reduces the activation of angiogenic growth factors VEGF and FGF-2[1][2]. |
| Name | Synstatin (92-119) |
|---|
| Description | Synstatin (92-119) is an anti-tumor agent that inhibits angiogenesis and cancer cell invasion. Synstatin (92-119) down-regulates integrin α?β3 and reduces the activation of angiogenic growth factors VEGF and FGF-2[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C133H207N35O46 |
|---|---|
| Molecular Weight | 3032.27 |
| InChIKey | ZRFCJNAJRWUHMX-CFNXPHSLSA-N |
| SMILES | CC(C)CC(N)C(=O)N1CCCC1C(=O)NC(C)C(=O)NCC(=O)NC(CCC(=O)O)C(=O)NC(CCCCN)C(=O)N1CCCC1C(=O)NC(CCC(=O)O)C(=O)NC(CCC(=O)O)C(=O)NCC(=O)NC(CCC(=O)O)C(=O)N1CCCC1C(=O)NC(C(=O)NC(CC(C)C)C(=O)NC(Cc1cnc[nH]1)C(=O)NC(C(=O)NC(CCC(=O)O)C(=O)NC(C)C(=O)NC(CCC(=O)O)C(=O)N1CCCC1C(=O)NCC(=O)NC(Cc1ccccc1)C(=O)NC(C(=O)NC(C)C(=O)NC(CCCNC(=N)N)C(=O)NC(CC(=O)O)C(=O)NC(CCCCN)C(=O)NC(CCC(=O)O)C(=O)O)C(C)O)C(C)C)C(C)C |