2-(hexylamino)-3,7-dihydropurin-6-one structure
|
Common Name | 2-(hexylamino)-3,7-dihydropurin-6-one | ||
|---|---|---|---|---|
| CAS Number | 123994-82-1 | Molecular Weight | 235.28600 | |
| Density | 1.36g/cm3 | Boiling Point | 477ºC at 760 mmHg | |
| Molecular Formula | C11H17N5O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 242.3ºC | |
| Name | 2-(hexylamino)-3,7-dihydropurin-6-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.36g/cm3 |
|---|---|
| Boiling Point | 477ºC at 760 mmHg |
| Molecular Formula | C11H17N5O |
| Molecular Weight | 235.28600 |
| Flash Point | 242.3ºC |
| Exact Mass | 235.14300 |
| PSA | 89.95000 |
| LogP | 1.47260 |
| Vapour Pressure | 2.92E-09mmHg at 25°C |
| Index of Refraction | 1.664 |
| InChIKey | GKSZXMSYBGLUJH-UHFFFAOYSA-N |
| SMILES | CCCCCCNc1nc2nc[nH]c2c(=O)[nH]1 |
|
~55%
2-(hexylamino)-... CAS#:123994-82-1 |
| Literature: Journal of Medicinal Chemistry, , vol. 33, # 1 p. 203 - 206 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 6H-Purin-6-one,2-(hexylamino)-1,9-dihydro |
| 9H-Purin-6-ol,2-(hexylamino) |