2-Bromohypoxanthine
Modify Date: 2025-08-21 16:14:32
2-Bromohypoxanthine structure
|
Common Name | 2-Bromohypoxanthine | ||
|---|---|---|---|---|
| CAS Number | 87781-93-9 | Molecular Weight | 215.00800 | |
| Density | 2.54g/cm3 | Boiling Point | 536.7ºC at 760 mmHg | |
| Molecular Formula | C5H3BrN4O | Melting Point | >350ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 278.4ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2-bromo-3,7-dihydropurin-6-one |
|---|---|
| Synonym | More Synonyms |
| Density | 2.54g/cm3 |
|---|---|
| Boiling Point | 536.7ºC at 760 mmHg |
| Melting Point | >350ºC(lit.) |
| Molecular Formula | C5H3BrN4O |
| Molecular Weight | 215.00800 |
| Flash Point | 278.4ºC |
| Exact Mass | 213.94900 |
| PSA | 74.43000 |
| LogP | 0.40870 |
| Index of Refraction | 1.958 |
| InChIKey | ONXCBJOMYNPZNI-UHFFFAOYSA-N |
| SMILES | O=c1[nH]c(Br)nc2nc[nH]c12 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2933990090 |
|
~52%
2-Bromohypoxanthine CAS#:87781-93-9 |
| Literature: Loeppky, Richard N.; Shi, Jianzheng Chemical Research in Toxicology, 2008 , vol. 21, # 2 p. 319 - 329 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Supercritical fluid extraction as a preparation method for mass spectrometry of dried blood spots.
J. Chromatogr. B. Analyt. Technol. Biomed. Life Sci. 969 , 199-204, (2014) The potential of supercritical fluid extraction (SFE) as a preparation method for mass spectrometry of dried blood spots (DBS) was examined. SFE is generally used for the extraction of hydrophobic com... |
| 2-bromohydropurin-6-one |
| 2-bromo-6-oxopurine |
| 2-BROMO-6-HYDROXY-PURINE |
| 2-bromo-hypoxanthine |
| MFCD03093927 |
| 2-Bromo-1H-purin-6(7H)-one |
| 2-bromo-1,9-dihydro-purin-6-one |