2-(benzylamino)-3,7-dihydropurin-6-one structure
|
Common Name | 2-(benzylamino)-3,7-dihydropurin-6-one | ||
|---|---|---|---|---|
| CAS Number | 5711-37-5 | Molecular Weight | 241.24900 | |
| Density | 1.56g/cm3 | Boiling Point | 660ºC at 760 mmHg | |
| Molecular Formula | C12H11N5O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 353ºC | |
| Name | 2-(benzylamino)-3,7-dihydropurin-6-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.56g/cm3 |
|---|---|
| Boiling Point | 660ºC at 760 mmHg |
| Molecular Formula | C12H11N5O |
| Molecular Weight | 241.24900 |
| Flash Point | 353ºC |
| Exact Mass | 241.09600 |
| PSA | 89.95000 |
| LogP | 1.09250 |
| Index of Refraction | 1.745 |
| InChIKey | XWNJMSJGJFSGRY-UHFFFAOYSA-N |
| SMILES | O=c1[nH]c(NCc2ccccc2)nc2nc[nH]c12 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| N2-Benzylguanin |
| N2-benzylguanine |
| 2-benzylamino-1,9-dihydro-purin-6-one |