Prepro VIP (111-122), human structure
|
Common Name | Prepro VIP (111-122), human | ||
|---|---|---|---|---|
| CAS Number | 123025-94-5 | Molecular Weight | 1242.33 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 1700.7±65.0 °C at 760 mmHg | |
| Molecular Formula | C53H87N13O21 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 982.4±34.3 °C | |
Use of Prepro VIP (111-122), humanPrepro VIP (111-122), human is a prepro-vasoactive intestinal polypeptide (VIP)–derived peptide, corresponding to residues 111-122. VIP is present in the peripheral and the central nervous systems where it functions as a nonadrenergic, noncholinergic neurotransmitter or neuromodulator[1][2]. |
| Name | L-Valyl-L-seryl-L-seryl-L-asparaginyl-L-isoleucyl-L-seryl-L-α-glutamyl-L-α-aspartyl-L-prolyl-L-valyl-L-prolyl-L-valine |
|---|---|
| Synonym | More Synonyms |
| Description | Prepro VIP (111-122), human is a prepro-vasoactive intestinal polypeptide (VIP)–derived peptide, corresponding to residues 111-122. VIP is present in the peripheral and the central nervous systems where it functions as a nonadrenergic, noncholinergic neurotransmitter or neuromodulator[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 1700.7±65.0 °C at 760 mmHg |
| Molecular Formula | C53H87N13O21 |
| Molecular Weight | 1242.33 |
| Flash Point | 982.4±34.3 °C |
| Exact Mass | 1241.613892 |
| LogP | -0.52 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.568 |
| InChIKey | HKKDGJFKJBWDQK-FYKWFVNCSA-N |
| SMILES | CCC(C)C(NC(=O)C(CC(N)=O)NC(=O)C(CO)NC(=O)C(CO)NC(=O)C(N)C(C)C)C(=O)NC(CO)C(=O)NC(CCC(=O)O)C(=O)NC(CC(=O)O)C(=O)N1CCCC1C(=O)NC(C(=O)N1CCCC1C(=O)NC(C(=O)O)C(C)C)C(C)C |
| L-Valyl-L-seryl-L-seryl-L-asparaginyl-L-isoleucyl-L-seryl-L-α-glutamyl-L-α-aspartyl-L-prolyl-L-valyl-L-prolyl-L-valine |
| L-Valine, L-valyl-L-seryl-L-seryl-L-asparaginyl-L-isoleucyl-L-seryl-L-α-glutamyl-L-α-aspartyl-L-prolyl-L-valyl-L-prolyl- |