3-[4-(dimethylamino)phenyl]-1,5-diphenylpentane-1,5-dione structure
|
Common Name | 3-[4-(dimethylamino)phenyl]-1,5-diphenylpentane-1,5-dione | ||
|---|---|---|---|---|
| CAS Number | 103046-32-8 | Molecular Weight | 371.47200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C25H25NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-[4-(dimethylamino)phenyl]-1,5-diphenylpentane-1,5-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C25H25NO2 |
|---|---|
| Molecular Weight | 371.47200 |
| Exact Mass | 371.18900 |
| PSA | 37.38000 |
| LogP | 5.38220 |
| InChIKey | JVZLAWVUBOIKNM-UHFFFAOYSA-N |
| SMILES | CN(C)c1ccc(C(CC(=O)c2ccccc2)CC(=O)c2ccccc2)cc1 |
|
~%
3-[4-(dimethyla... CAS#:103046-32-8 |
| Literature: Mac Lean; Widdows Journal of the Chemical Society, 1914 , vol. 105, p. 2172,2173 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 3-(4-dimethylamino-phenyl)-1,5-diphenyl-pentane-1,5-dione |
| 1,5-Pentanedione,3-[4-(dimethylamino)phenyl]-1,5-diphenyl |
| 3-(4-Dimethylamino-phenyl)-1,5-diphenyl-pentan-1,5-dion |