4-(2,6-diphenyl-4-pyridyl)-N,N-dimethylaniline structure
|
Common Name | 4-(2,6-diphenyl-4-pyridyl)-N,N-dimethylaniline | ||
|---|---|---|---|---|
| CAS Number | 29312-59-2 | Molecular Weight | 350.45600 | |
| Density | 1.107g/cm3 | Boiling Point | 506.6ºC at 760mmHg | |
| Molecular Formula | C25H22N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 260.2ºC | |
| Name | 4-(2,6-diphenylpyridin-4-yl)-N,N-dimethylaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.107g/cm3 |
|---|---|
| Boiling Point | 506.6ºC at 760mmHg |
| Molecular Formula | C25H22N2 |
| Molecular Weight | 350.45600 |
| Flash Point | 260.2ºC |
| Exact Mass | 350.17800 |
| PSA | 16.13000 |
| LogP | 6.14860 |
| Vapour Pressure | 2.19E-10mmHg at 25°C |
| Index of Refraction | 1.628 |
| InChIKey | NWKIYBPNACDLOB-UHFFFAOYSA-N |
| SMILES | CN(C)c1ccc(-c2cc(-c3ccccc3)nc(-c3ccccc3)c2)cc1 |
| HS Code | 2933399090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| t0505-1333 |
| einecs 249-551-0 |