1,2-bis(3-methoxyphenyl)hydrazine
Modify Date: 2025-11-25 13:15:12
1,2-bis(3-methoxyphenyl)hydrazine structure
|
Common Name | 1,2-bis(3-methoxyphenyl)hydrazine | ||
|---|---|---|---|---|
| CAS Number | 1027-32-3 | Molecular Weight | 244.28900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H16N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,2-bis(3-methoxyphenyl)hydrazine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H16N2O2 |
|---|---|
| Molecular Weight | 244.28900 |
| Exact Mass | 244.12100 |
| PSA | 42.52000 |
| LogP | 3.28880 |
| InChIKey | GBRNPPYPZLRRSI-UHFFFAOYSA-N |
| SMILES | COc1cccc(NNc2cccc(OC)c2)c1 |
| HS Code | 2928000090 |
|---|
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| Hydrazine,1,2-bis(3-methoxyphenyl) |