prohydrojasmon structure
|
Common Name | prohydrojasmon | ||
|---|---|---|---|---|
| CAS Number | 158474-72-7 | Molecular Weight | 254.365 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 340.2±15.0 °C at 760 mmHg | |
| Molecular Formula | C15H26O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 145.3±20.4 °C | |
Use of prohydrojasmonProhydrojasmon racemate is a synthesized plant gowth regulator. |
| Name | prohydrojasmon |
|---|---|
| Synonym | More Synonyms |
| Description | Prohydrojasmon racemate is a synthesized plant gowth regulator. |
|---|---|
| Related Catalog | |
| In Vitro | Prohydrojasmon racemate (n-propyl dihydrojasmonate, PDJ) is a functional analogue of Jasmonic acid (JA) [1]. Prohydrojasmon racemate (n-propyl dihydrojasmonate, PDJ) is a plant growth promoter[2]. |
| References |
[2]. Shin-ichi Hirakawa, et al. Plant growth promoter comprising jasmonate and brassinolide. US5814581A. |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 340.2±15.0 °C at 760 mmHg |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.365 |
| Flash Point | 145.3±20.4 °C |
| Exact Mass | 254.188202 |
| PSA | 43.37000 |
| LogP | 3.56 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.456 |
| InChIKey | IPDFPNNPBMREIF-UHFFFAOYSA-N |
| SMILES | CCCCCC1C(=O)CCC1CC(=O)OCCC |
| Storage condition | 0-6°C |
| Hazard Codes | Xi |
|---|
| Prohydrojasmon [ISO] |
| propyl (1RS,2RS)-(3-oxo-2-pentylcyclopentyl)acetate containing 10±2% propyl (1RS,2SR)-(3-oxo-2-pentylcyclopentyl)acetate |
| propyl (1R,2R)-rel-3-oxo-2-pentylcyclopentaneacetate |
| propyl 2-[(1R,2R)-3-oxo-2-pentylcyclopentyl]acetate |
| rac-propyl (1R,2R)-(3-oxo-2-pentylcyclopentyl)acetate containing 10±2% rac-propyl (1R,2S)-(3-oxo-2-pentylcyclopentyl)acetate |
| PDJ |
| propyl dihydrojasmonate |
| prohydrojasmon |
| Propyl [(1R,2R)-3-oxo-2-pentylcyclopentyl]acetate |
| propyl 2-(3-oxo-2-pentylcyclopentyl)acetate |
| Prohydrojasmon racemate |