Dibenzyl carbonimidoylbiscarbamate
Dibenzyl carbonimidoylbiscarbamate structure
|
Common Name | Dibenzyl carbonimidoylbiscarbamate | ||
|---|---|---|---|---|
| CAS Number | 10065-79-9 | Molecular Weight | 327.335 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C17H17N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | benzyl N-[amino(phenylmethoxycarbonylamino)methylidene]carbamate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Molecular Formula | C17H17N3O4 |
| Molecular Weight | 327.335 |
| Exact Mass | 327.121918 |
| PSA | 100.51000 |
| LogP | 2.55 |
| Index of Refraction | 1.586 |
| InChIKey | WUPOXNUSSFCSGV-UHFFFAOYSA-N |
| SMILES | NC(=NC(=O)OCc1ccccc1)NC(=O)OCc1ccccc1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | C |
|---|
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 6 | |
|---|---|
| DownStream 1 | |
CAS#:50-01-1
CAS#:501-53-1
CAS#:25508-20-7
CAS#:152120-62-2
CAS#:13139-17-8
CAS#:113-00-8
CAS#:207857-19-0This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| N,N'-Dicarbamylformamidine |
| FORMAMIDINE,N,N'-DICARBAMOYL |
| N,N'-bis-Cbz-guanidine |
| Urea,1'-methylidynedi |
| Formamidine,N'-dicarbamoyl |
| N,N'-di-Cbz-guanidine |
| Carbamic acid, N,N'-carbonimidoylbis-, bis(phenylmethyl) ester |
| Dibenzyl carbonimidoylbiscarbamate |
| N,N'-Dicarbamoylformamidine |
| Urea,1,1'-methylidynedi |
| N,N'-Dicarbonylformamidin |
| N1,N3-Dibenzyloxycarbonylguanidin |
| N,N'-bis(benzyloxycarbonyl)guanidine |
| N,N'-di(benzyloxycarbonyl)guanidine |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of benzyl N-[amino(phenylmethoxycarbonylamino)methylidene]carbamate? |
| A: SMILES notation of benzyl N-[amino(phenylmethoxycarbonylamino)methylidene]carbamate is NC(=NC(=O)OCc1ccccc1)NC(=O)OCc1ccccc1. |
| Q: What are the upstream materials of benzyl N-[amino(phenylmethoxycarbonylamino)methylidene]carbamate? |
| A: Related upstream materials(CAS) of benzyl N-[amino(phenylmethoxycarbonylamino)methylidene]carbamate: 50-01-1;501-53-1;25508-20-7;152120-62-2;13139-17-8;113-00-8. |
| Q: What is the molecular weight of benzyl N-[amino(phenylmethoxycarbonylamino)methylidene]carbamate? |
| A: Molecular weight of benzyl N-[amino(phenylmethoxycarbonylamino)methylidene]carbamate is 327.335. |
| Q: What is the InChIKey of benzyl N-[amino(phenylmethoxycarbonylamino)methylidene]carbamate? |
| A: InChIKey of benzyl N-[amino(phenylmethoxycarbonylamino)methylidene]carbamate is WUPOXNUSSFCSGV-UHFFFAOYSA-N. |
| Q: What is the CAS number of benzyl N-[amino(phenylmethoxycarbonylamino)methylidene]carbamate? |
| A: CAS number of benzyl N-[amino(phenylmethoxycarbonylamino)methylidene]carbamate is 10065-79-9. |
| Q: What is the LogP of benzyl N-[amino(phenylmethoxycarbonylamino)methylidene]carbamate? |
| A: LogP of benzyl N-[amino(phenylmethoxycarbonylamino)methylidene]carbamate is 2.55. |
| Q: What is the English name of benzyl N-[amino(phenylmethoxycarbonylamino)methylidene]carbamate? |
| A: The English name of benzyl N-[amino(phenylmethoxycarbonylamino)methylidene]carbamate is benzyl N-[amino(phenylmethoxycarbonylamino)methylidene]carbamate. |
| Q: What is the polar surface area (PSA) of benzyl N-[amino(phenylmethoxycarbonylamino)methylidene]carbamate? |
| A: Polar surface area (PSA) of benzyl N-[amino(phenylmethoxycarbonylamino)methylidene]carbamate is 100.51000. |
| Q: What is the molecular formula of benzyl N-[amino(phenylmethoxycarbonylamino)methylidene]carbamate? |
| A: Molecular formula of benzyl N-[amino(phenylmethoxycarbonylamino)methylidene]carbamate is C17H17N3O4. |
| Q: What are the downstream products of benzyl N-[amino(phenylmethoxycarbonylamino)methylidene]carbamate? |
| A: Related downstream products(CAS) of benzyl N-[amino(phenylmethoxycarbonylamino)methylidene]carbamate: 207857-19-0. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |