(2-OXO-PYRROLIDIN-3-YL)-CARBAMIC ACID BENZYL ESTER
(2-OXO-PYRROLIDIN-3-YL)-CARBAMIC ACID BENZYL ESTER structure
|
Common Name | (2-OXO-PYRROLIDIN-3-YL)-CARBAMIC ACID BENZYL ESTER | ||
|---|---|---|---|---|
| CAS Number | 118507-50-9 | Molecular Weight | 234.25100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H14N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | benzyl N-[(3S)-2-oxopyrrolidin-3-yl]carbamate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H14N2O3 |
|---|---|
| Molecular Weight | 234.25100 |
| Exact Mass | 234.10000 |
| PSA | 74.41000 |
| LogP | 1.28160 |
| InChIKey | DAMJCWMGELCIMI-JTQLQIEISA-N |
| SMILES | O=C(NC1CCNC1=O)OCc1ccccc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 8 | |
|---|---|
| DownStream 1 | |
CAS#:92235-34-2This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| MFCD08273940 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of benzyl N-[(3S)-2-oxopyrrolidin-3-yl]carbamate? |
| A: Polar surface area (PSA) of benzyl N-[(3S)-2-oxopyrrolidin-3-yl]carbamate is 74.41000. |
| Q: What is the InChIKey of benzyl N-[(3S)-2-oxopyrrolidin-3-yl]carbamate? |
| A: InChIKey of benzyl N-[(3S)-2-oxopyrrolidin-3-yl]carbamate is DAMJCWMGELCIMI-JTQLQIEISA-N. |
| Q: What is the SMILES notation of benzyl N-[(3S)-2-oxopyrrolidin-3-yl]carbamate? |
| A: SMILES notation of benzyl N-[(3S)-2-oxopyrrolidin-3-yl]carbamate is O=C(NC1CCNC1=O)OCc1ccccc1. |
| Q: What is the LogP of benzyl N-[(3S)-2-oxopyrrolidin-3-yl]carbamate? |
| A: LogP of benzyl N-[(3S)-2-oxopyrrolidin-3-yl]carbamate is 1.28160. |
| Q: What is the molecular formula of benzyl N-[(3S)-2-oxopyrrolidin-3-yl]carbamate? |
| A: Molecular formula of benzyl N-[(3S)-2-oxopyrrolidin-3-yl]carbamate is C12H14N2O3. |
| Q: What is the CAS number of benzyl N-[(3S)-2-oxopyrrolidin-3-yl]carbamate? |
| A: CAS number of benzyl N-[(3S)-2-oxopyrrolidin-3-yl]carbamate is 118507-50-9. |
| Q: What English synonyms does benzyl N-[(3S)-2-oxopyrrolidin-3-yl]carbamate have? |
| A: English synonyms of benzyl N-[(3S)-2-oxopyrrolidin-3-yl]carbamate: MFCD08273940. |
| Q: What is the molecular weight of benzyl N-[(3S)-2-oxopyrrolidin-3-yl]carbamate? |
| A: Molecular weight of benzyl N-[(3S)-2-oxopyrrolidin-3-yl]carbamate is 234.25100. |
| Q: What are the downstream products of benzyl N-[(3S)-2-oxopyrrolidin-3-yl]carbamate? |
| A: Related downstream products(CAS) of benzyl N-[(3S)-2-oxopyrrolidin-3-yl]carbamate: 92235-34-2. |
| Q: What are the upstream materials of benzyl N-[(3S)-2-oxopyrrolidin-3-yl]carbamate? |
| A: Related upstream materials(CAS) of benzyl N-[(3S)-2-oxopyrrolidin-3-yl]carbamate: 13907-82-9;182618-33-3;2650-64-8;4668-43-3;4515-23-5;849411-39-8;849411-40-1;62234-40-6. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |