n-carbobenzyloxy-l-aspartic anhydride structure
|
Common Name | n-carbobenzyloxy-l-aspartic anhydride | ||
|---|---|---|---|---|
| CAS Number | 4515-23-5 | Molecular Weight | 249.21900 | |
| Density | 1.37g/cm3 | Boiling Point | 490.232ºC at 760 mmHg | |
| Molecular Formula | C12H11NO5 | Melting Point | 123-124ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 250.283ºC | |
Use of n-carbobenzyloxy-l-aspartic anhydrideCbz-L-Aspartic anhydride is an aspartic acid derivative[1]. |
| Name | benzyl N-[(3S)-2,5-dioxooxolan-3-yl]carbamate |
|---|---|
| Synonym | More Synonyms |
| Description | Cbz-L-Aspartic anhydride is an aspartic acid derivative[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Amino acids and amino acid derivatives have been commercially used as ergogenic supplements. They influence the secretion of anabolic hormones, supply of fuel during exercise, mental performance during stress related tasks and prevent exercise induced muscle damage. They are recognized to be beneficial as ergogenic dietary substances[1]. |
| References |
| Density | 1.37g/cm3 |
|---|---|
| Boiling Point | 490.232ºC at 760 mmHg |
| Melting Point | 123-124ºC(lit.) |
| Molecular Formula | C12H11NO5 |
| Molecular Weight | 249.21900 |
| Flash Point | 250.283ºC |
| Exact Mass | 249.06400 |
| PSA | 81.70000 |
| LogP | 1.14580 |
| Index of Refraction | 1.573 |
| InChIKey | OZPYEGOBGWQOSZ-VIFPVBQESA-N |
| SMILES | O=C1CC(NC(=O)OCc2ccccc2)C(=O)O1 |
| RIDADR | NONH for all modes of transport |
|---|---|
| WGK Germany | 3 |
| HS Code | 2924299090 |
|
~97%
n-carbobenzylox... CAS#:4515-23-5 |
| Literature: Heinzel, Wolfgang; Kronbach, Thomas; Voelter, Wolfgang Zeitschrift fuer Naturforschung, Teil B: Anorganische Chemie, Organische Chemie, 1982 , vol. 37, # 12 p. 1652 - 1658 |
|
~%
n-carbobenzylox... CAS#:4515-23-5 |
| Literature: McGarvey, Glenn J.; Hiner, Roger N; Matsubara, Yoshio; Oh, Taeboem Tetrahedron Letters, 1983 , vol. 24, # 27 p. 2733 - 2736 |
|
~%
n-carbobenzylox... CAS#:4515-23-5 |
| Literature: Bergmann; Zervas Chemische Berichte, 1932 , vol. 65, p. 1192,1198 |
|
~%
n-carbobenzylox... CAS#:4515-23-5 |
| Literature: Buron, Frederic; Deguest, Geoffrey; Bischoff, Laurent; Fruit, Corinne; Marsais, Francis Tetrahedron Asymmetry, 2007 , vol. 18, # 13 p. 1625 - 1627 |
| Precursor 3 | |
|---|---|
| DownStream 10 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-carbobenzyloxy-L-aspartic acid anhydride |
| N-benzyloxycarbonyl-L-aspartic acid anhydride |
| N-Cbz-L-Aspartic anhydride |
| N-Carbobenzyloxy-L-aspartic anhydride |
| benzyloxycarbonyl-L-aspartic anhydride |
| carbobenzoxy-L-aspartic acid anhydride |
| N-benzyloxycarbonyl-L-aspartic anhydride |
| N-Z-L-aspartic anhydride |
| EINECS 224-838-3 |
| MFCD00136820 |