(S)-4,5-DIHYDRO-2-(2-((S)-4,5-DIHYDRO-4-ISOPROPYLOXAZOL-2-YL)PROPAN-2-YL)-4-ISOPROPYLOXAZOLE structure
|
Common Name | (S)-4,5-DIHYDRO-2-(2-((S)-4,5-DIHYDRO-4-ISOPROPYLOXAZOL-2-YL)PROPAN-2-YL)-4-ISOPROPYLOXAZOLE | ||
|---|---|---|---|---|
| CAS Number | 131833-92-6 | Molecular Weight | 266.37900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H26N2O2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 125 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | (4S)-4-propan-2-yl-2-[2-[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]propan-2-yl]-4,5-dihydro-1,3-oxazole |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H26N2O2 |
|---|---|
| Molecular Weight | 266.37900 |
| Flash Point | 125 °C |
| Exact Mass | 266.19900 |
| PSA | 43.18000 |
| LogP | 1.79040 |
| Index of Refraction | 1.47 |
| InChIKey | XFZUPCITFHSROM-VXGBXAGGSA-N |
| SMILES | CC(C)C1COC(C(C)(C)C2=NC(C(C)C)CO2)=N1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H319 |
| Precautionary Statements | P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| RIDADR | NONH for all modes of transport |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
|
Organic Synth. 83 , 97, (2005)
|
| S,S-di-isopropyl gem-dimethyl bisoxazoline |