4,4'-Dichloro-2,2'-bipyridine structure
|
Common Name | 4,4'-Dichloro-2,2'-bipyridine | ||
|---|---|---|---|---|
| CAS Number | 1762-41-0 | Molecular Weight | 225.074 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 333.7±37.0 °C at 760 mmHg | |
| Molecular Formula | C10H6Cl2N2 | Melting Point | 126-128 °C | |
| MSDS | N/A | Flash Point | 185.9±12.1 °C | |
| Name | 4-chloro-2-(4-chloropyridin-2-yl)pyridine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 333.7±37.0 °C at 760 mmHg |
| Melting Point | 126-128 °C |
| Molecular Formula | C10H6Cl2N2 |
| Molecular Weight | 225.074 |
| Flash Point | 185.9±12.1 °C |
| Exact Mass | 223.990799 |
| PSA | 25.78000 |
| LogP | 2.12 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.605 |
| InChIKey | UBSRTSGCWBPLQF-UHFFFAOYSA-N |
| SMILES | Clc1ccnc(-c2cc(Cl)ccn2)c1 |
| Hazard Codes | T+ |
|---|---|
| HS Code | 2933399090 |
| Precursor 10 | |
|---|---|
| DownStream 3 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4,4'-dichloro-2,2'-bipy |
| 4,4'-Dichloro-2,2'-bipyridine |
| 4,4'-dichloro-2,2'-bipyridyl |
| 4,4'-Dichloro-2,2'-bipyridin |
| 4,4'-Dichlor-[2,2']bipyridyl |
| 2,2'-Bipyridine,4,4'-dichloro |
| 4,4'-Dichloro-[2,2']bipyridinyl |