Oseltamivir
Oseltamivir structure
|
Common Name | Oseltamivir | ||
|---|---|---|---|---|
| CAS Number | 196618-13-0 | Molecular Weight | 312.40 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 445.4±55.0 °C at 760 mmHg | |
| Molecular Formula | C16H28N2O4 | Melting Point | 109 °C | |
| MSDS | N/A | Flash Point | 223.2±31.5 °C | |
Use of OseltamivirOseltamivir (GS 4104) is an orally active influenza virus neuraminidase inhibitor (NAI). Oseltamivir inhibits influenza A/H3N2, A/H1N2, A/H1N1, and B viruses with mean IC50s of 0.67, 0.9, 1.34 and 13 nM, respectively[1]. |
Summary: Oseltamivir (CAS No.: 196618-13-0), molecular formula C16H28N2O4, molecular weight 312.40, is a white to light yellow powder or crystalline solid with a melting point of 109 °C. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | oseltamivir |
|---|---|
| Synonym | More Synonyms |
This table contains bioactivity, target information and biological‑assay experimental data of this compound.
| Description | Oseltamivir (GS 4104) is an orally active influenza virus neuraminidase inhibitor (NAI). Oseltamivir inhibits influenza A/H3N2, A/H1N2, A/H1N1, and B viruses with mean IC50s of 0.67, 0.9, 1.34 and 13 nM, respectively[1]. |
|---|---|
| Related Catalog | |
| References |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 445.4±55.0 °C at 760 mmHg |
| Melting Point | 109 °C |
| Molecular Formula | C16H28N2O4 |
| Molecular Weight | 312.40 |
| Flash Point | 223.2±31.5 °C |
| Exact Mass | 312.204895 |
| PSA | 90.65000 |
| LogP | 2.52 |
| Vapour Pressure | 0.0±2.4 mmHg at 25°C |
| Index of Refraction | 1.529 |
| InChIKey | VSZGPKBBMSAYNT-RRFJBIMHSA-N |
| SMILES | CCOC(=O)C1=CC(OC(CC)CC)C(NC(C)=O)C(N)C1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 6 | |
|---|---|
| DownStream 1 | |
CAS#:312904-18-0
CAS#:204255-06-1
CAS#:1041262-68-3
CAS#:367252-68-4
CAS#:1443055-49-9
CAS#:64-17-5
CAS#:204255-11-8This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| OSELTAMIVIR |
| (3R,4R,5S)-4-acetamido-5-amino-3-(1-ethylpropoxy)-1-cyclohexene-1-carboxylic acid ethyl ester |
| Oseltamivir (free base) |
| TaMvir |
| GOP-A-Flu |
| (3R,5S)-ethyl 4-acetamido-5-amino-3-(pentan-3-yloxy)cyclohex-1-enecarboxylate |
| TaMiflu-Free |
| TAMIFLU |
| (3R,4R,5S)-4-acetylamino-5-amino-3(1-ethylpropoxy)-1-cyclohexene-1-carboxylic acid ethyl ester |
| OSTELTAMIVIR |
| (3R,4R,5S)-5-amino-4-acetylamino-3-(1-ethyl-propoxy)-cyclohex-1-ene-carboxylic acid ethyl ester |
| GS 4104 |
| ethyl (3R,4R,5S)-5-aMino-4-acetaMido-3-(pentan-3-yloxy)cyclohex-1-ene-1-carboxylate |
| [14C]-Oseltamivir |
| ethyl (3R,4R,5S)-4-acetamido-5-amino-3-(1-ethylpropoxy)-1-cyclohexene-1-carboxylate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of oseltamivir? |
| A: Molecular weight of oseltamivir is 312.40. |
| Q: What is the SMILES notation of oseltamivir? |
| A: SMILES notation of oseltamivir is CCOC(=O)C1=CC(OC(CC)CC)C(NC(C)=O)C(N)C1. |
| Q: What is the English name of oseltamivir? |
| A: The English name of oseltamivir is oseltamivir. |
| Q: What are the uses of oseltamivir? |
| A: Main uses of oseltamivir: Oseltamivir (GS 4104) is an orally active influenza virus neuraminidase inhibitor (NAI). Oseltamivir inhibits influenza A/H3N2, A/H1N2, A/H1N1, and B viruses with mean IC50s of 0.67, 0.9, 1.34 and 13 nM, respectively[1]. |
| Q: What is the polar surface area (PSA) of oseltamivir? |
| A: Polar surface area (PSA) of oseltamivir is 90.65000. |
| Q: What is the boiling point of oseltamivir? |
| A: Boiling point of oseltamivir is 445.4±55.0 °C at 760 mmHg. |
| Q: What is the LogP of oseltamivir? |
| A: LogP of oseltamivir is 2.52. |
| Q: What is the InChIKey of oseltamivir? |
| A: InChIKey of oseltamivir is VSZGPKBBMSAYNT-RRFJBIMHSA-N. |
| Q: What is the molecular formula of oseltamivir? |
| A: Molecular formula of oseltamivir is C16H28N2O4. |
| Q: What is the CAS number of oseltamivir? |
| A: CAS number of oseltamivir is 196618-13-0. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |