2,2':6',2''-Terpyridine-4,4',4''-tricarboxylic acid
2,2':6',2''-Terpyridine-4,4',4''-tricarboxylic acid structure
|
Common Name | 2,2':6',2''-Terpyridine-4,4',4''-tricarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 216018-58-5 | Molecular Weight | 365.296 | |
| Density | 1.539 | Boiling Point | 890.3±65.0 °C at 760 mmHg | |
| Molecular Formula | C18H11N3O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 492.2±34.3 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,6-bis(4-carboxypyridin-2-yl)pyridine-4-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.539 |
|---|---|
| Boiling Point | 890.3±65.0 °C at 760 mmHg |
| Molecular Formula | C18H11N3O6 |
| Molecular Weight | 365.296 |
| Flash Point | 492.2±34.3 °C |
| Exact Mass | 365.064789 |
| PSA | 150.57000 |
| LogP | 2.31 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Index of Refraction | 1.688 |
| InChIKey | NTXWAWVRPLVLKC-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccnc(-c2cc(C(=O)O)cc(-c3cc(C(=O)O)ccn3)n2)c1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xi |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~37%
2,2':6',2''-Ter... CAS#:216018-58-5 |
| Literature: Dehaudt, Jeremy; Husson, Jerome; Guyard, Laurent Green Chemistry, 2011 , vol. 13, # 12 p. 3337 - 3340 |
|
~41%
2,2':6',2''-Ter... CAS#:216018-58-5 |
| Literature: Nazeeruddin; Pechy; Graetzel Chemical Communications, 1997 , # 18 p. 1705 - 1706 |
|
~%
2,2':6',2''-Ter... CAS#:216018-58-5 |
| Literature: Dehaudt, Jeremy; Husson, Jerome; Guyard, Laurent Green Chemistry, 2011 , vol. 13, # 12 p. 3337 - 3340 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| [2,2':6',2''-Terpyridine]-4,4',4''-tricarboxylic acid |
| 2,2':6',2''-pyridine-4,4',4''-tricarboxylic acid |
| 4,4',4"-tricarboxy-2,2':6',2"-terpyridine |
| 4,4',4''-tricarboxylic-2,2':6',2''-terpyridyl |
| 2,2'-THENOIN |
| 2,2':6',2''-Terpyridine-4,4',4''-tricarboxylic acid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 2,6-bis(4-carboxypyridin-2-yl)pyridine-4-carboxylic acid? |
| A: Molecular formula of 2,6-bis(4-carboxypyridin-2-yl)pyridine-4-carboxylic acid is C18H11N3O6. |
| Q: What is the molecular weight of 2,6-bis(4-carboxypyridin-2-yl)pyridine-4-carboxylic acid? |
| A: Molecular weight of 2,6-bis(4-carboxypyridin-2-yl)pyridine-4-carboxylic acid is 365.296. |
| Q: What is the LogP of 2,6-bis(4-carboxypyridin-2-yl)pyridine-4-carboxylic acid? |
| A: LogP of 2,6-bis(4-carboxypyridin-2-yl)pyridine-4-carboxylic acid is 2.31. |
| Q: What is the English name of 2,6-bis(4-carboxypyridin-2-yl)pyridine-4-carboxylic acid? |
| A: The English name of 2,6-bis(4-carboxypyridin-2-yl)pyridine-4-carboxylic acid is 2,6-bis(4-carboxypyridin-2-yl)pyridine-4-carboxylic acid. |
| Q: What is the boiling point of 2,6-bis(4-carboxypyridin-2-yl)pyridine-4-carboxylic acid? |
| A: Boiling point of 2,6-bis(4-carboxypyridin-2-yl)pyridine-4-carboxylic acid is 890.3±65.0 °C at 760 mmHg. |
| Q: What English synonyms does 2,6-bis(4-carboxypyridin-2-yl)pyridine-4-carboxylic acid have? |
| A: English synonyms of 2,6-bis(4-carboxypyridin-2-yl)pyridine-4-carboxylic acid: [2,2':6',2''-Terpyridine]-4,4',4''-tricarboxylic acid, 2,2':6',2''-pyridine-4,4',4''-tricarboxylic acid, 4,4',4"-tricarboxy-2,2':6',2"-terpyridine, 4,4',4''-tricarboxylic-2,2':6',2''-terpyridyl, 2,2'-THENOIN, 2,2':6',2''-Terpyridine-4,4',4''-tricarboxylic acid. |
| Q: What is the polar surface area (PSA) of 2,6-bis(4-carboxypyridin-2-yl)pyridine-4-carboxylic acid? |
| A: Polar surface area (PSA) of 2,6-bis(4-carboxypyridin-2-yl)pyridine-4-carboxylic acid is 150.57000. |
| Q: What is the InChIKey of 2,6-bis(4-carboxypyridin-2-yl)pyridine-4-carboxylic acid? |
| A: InChIKey of 2,6-bis(4-carboxypyridin-2-yl)pyridine-4-carboxylic acid is NTXWAWVRPLVLKC-UHFFFAOYSA-N. |
| Q: What is the CAS number of 2,6-bis(4-carboxypyridin-2-yl)pyridine-4-carboxylic acid? |
| A: CAS number of 2,6-bis(4-carboxypyridin-2-yl)pyridine-4-carboxylic acid is 216018-58-5. |
| Q: What is the SMILES notation of 2,6-bis(4-carboxypyridin-2-yl)pyridine-4-carboxylic acid? |
| A: SMILES notation of 2,6-bis(4-carboxypyridin-2-yl)pyridine-4-carboxylic acid is O=C(O)c1ccnc(-c2cc(C(=O)O)cc(-c3cc(C(=O)O)ccn3)n2)c1. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |