4-(Methanesulfonyl)benzoyl chloride
4-(Methanesulfonyl)benzoyl chloride structure
|
Common Name | 4-(Methanesulfonyl)benzoyl chloride | ||
|---|---|---|---|---|
| CAS Number | 40913-92-6 | Molecular Weight | 218.65700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H7ClO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-methylsulfonylbenzoyl chloride |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H7ClO3S |
|---|---|
| Molecular Weight | 218.65700 |
| Exact Mass | 217.98000 |
| PSA | 59.59000 |
| LogP | 2.54990 |
| InChIKey | IPEIDGXNXFPGBG-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)c1ccc(C(=O)Cl)cc1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | C |
|---|---|
| HS Code | 2916399090 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 10 | |
|---|---|
| DownStream 9 | |
CAS#:4052-30-6
CAS#:79-37-8
CAS#:68-12-2
CAS#:623-13-2
CAS#:22821-76-7![Acetamide,N-[4-(methylsulfonyl)phenyl] Structure](https://image.chemsrc.com/caspic/164/22821-80-3.png)
CAS#:22821-80-3
CAS#:5470-49-5
CAS#:710-24-7
CAS#:824-79-3
CAS#:3185-99-7
CAS#:53606-06-7
CAS#:3112-85-4
CAS#:22821-70-1![[4-(Methylsulfonyl)phenyl]methanol structure](https://image.chemsrc.com/caspic/105/22821-77-8.png)
CAS#:22821-77-8![[4-[(2,2-dichloroacetyl)-methylamino]phenyl] 4-methylsulfonylbenzoate structure](https://image.chemsrc.com/caspic/162/3686-72-4.png)
CAS#:3686-72-4![N-[1-(4-methylsulfonylphenyl)-2-nitroethylidene]hydroxylamine structure](https://image.chemsrc.com/caspic/149/832717-24-5.png)
CAS#:832717-24-5
CAS#:832717-27-8![3-(4-methylsulfonylphenyl)-4H-[1,2]oxazolo[4,5-d]pyrimidin-7-one structure](https://image.chemsrc.com/caspic/497/832717-28-9.png)
CAS#:832717-28-9
CAS#:93629-02-8This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4-methanesulfonylbenzoyl chloride |
| p-(methylsulfonyl)benzoyl chloride |
| Benzoyl chloride,4-(methylsulfonyl) |
| 4-(methylsulfonyl)benzoyl chloride |
| 4-(methylsulphonyl)benzoyl chloride |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 4-methylsulfonylbenzoyl chloride? |
| A: LogP of 4-methylsulfonylbenzoyl chloride is 2.54990. |
| Q: What are the downstream products of 4-methylsulfonylbenzoyl chloride? |
| A: Related downstream products(CAS) of 4-methylsulfonylbenzoyl chloride: 53606-06-7;3112-85-4;22821-70-1;22821-77-8;3686-72-4;832717-24-5;832717-27-8;832717-28-9;93629-02-8. |
| Q: What is the molecular weight of 4-methylsulfonylbenzoyl chloride? |
| A: Molecular weight of 4-methylsulfonylbenzoyl chloride is 218.65700. |
| Q: What is the SMILES notation of 4-methylsulfonylbenzoyl chloride? |
| A: SMILES notation of 4-methylsulfonylbenzoyl chloride is CS(=O)(=O)c1ccc(C(=O)Cl)cc1. |
| Q: What is the polar surface area (PSA) of 4-methylsulfonylbenzoyl chloride? |
| A: Polar surface area (PSA) of 4-methylsulfonylbenzoyl chloride is 59.59000. |
| Q: What is the InChIKey of 4-methylsulfonylbenzoyl chloride? |
| A: InChIKey of 4-methylsulfonylbenzoyl chloride is IPEIDGXNXFPGBG-UHFFFAOYSA-N. |
| Q: What English synonyms does 4-methylsulfonylbenzoyl chloride have? |
| A: English synonyms of 4-methylsulfonylbenzoyl chloride: 4-methanesulfonylbenzoyl chloride, p-(methylsulfonyl)benzoyl chloride, Benzoyl chloride,4-(methylsulfonyl), 4-(methylsulfonyl)benzoyl chloride, 4-(methylsulphonyl)benzoyl chloride. |
| Q: What is the English name of 4-methylsulfonylbenzoyl chloride? |
| A: The English name of 4-methylsulfonylbenzoyl chloride is 4-methylsulfonylbenzoyl chloride. |
| Q: What is the molecular formula of 4-methylsulfonylbenzoyl chloride? |
| A: Molecular formula of 4-methylsulfonylbenzoyl chloride is C8H7ClO3S. |
| Q: What is the CAS number of 4-methylsulfonylbenzoyl chloride? |
| A: CAS number of 4-methylsulfonylbenzoyl chloride is 40913-92-6. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |