4-Methylsulfonyl benzoic acid structure
|
Common Name | 4-Methylsulfonyl benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 4052-30-6 | Molecular Weight | 200.212 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 432.4±37.0 °C at 760 mmHg | |
| Molecular Formula | C8H8O4S | Melting Point | 268-271 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 215.3±26.5 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4-Methylsulphonylbenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 432.4±37.0 °C at 760 mmHg |
| Melting Point | 268-271 °C(lit.) |
| Molecular Formula | C8H8O4S |
| Molecular Weight | 200.212 |
| Flash Point | 215.3±26.5 °C |
| Exact Mass | 200.014328 |
| PSA | 79.82000 |
| LogP | 0.67 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.560 |
| InChIKey | AJBWNNKDUMXZLM-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)c1ccc(C(=O)O)cc1 |
| Water Solubility | slight |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H319 |
| Precautionary Statements | P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn: Harmful;Xi: Irritant; |
| Risk Phrases | R22 |
| Safety Phrases | S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2916399090 |
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Dissociation constants of neutral and charged acids in methyl alcohol. The acid strength resolution. Rived F, et al.
Anal. Chim. Acta 374(2) , 309-324, (1998)
|
| 4-Methylsulfonyl benzoic acid |
| 4-(Methylsulfonyl)benzoic acid |
| 4-Methylsulfonylbenzoic acid |
| Benzoic acid, 4-(methylsulfonyl)- |
| EINECS 223-756-5 |
| MFCD00007564 |