H-His-Asp-OH
H-His-Asp-OH structure
|
Common Name | H-His-Asp-OH | ||
|---|---|---|---|---|
| CAS Number | 41658-60-0 | Molecular Weight | 270.24 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H14N4O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of H-His-Asp-OHH-His-Asp-OH is adipeptide. |
Summary: (S)-2-((S)-2-Aminopropylamino-3-(1H-imidazol-4-yl) succinamic acid, also known as L-Histidyl-L-aspartic acid or H-His-Asp-OH, has a CAS number of 41658-60-0, with a molecular formula of C10H14N4O5 and a molecular weight of 270.24. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | L-Histidyl-L-aspartic acid |
|---|---|
| Synonym | More Synonyms |
This table contains bioactivity, target information and biological‑assay experimental data of this compound.
| Description | H-His-Asp-OH is adipeptide. |
|---|---|
| Related Catalog |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H14N4O5 |
|---|---|
| Molecular Weight | 270.24 |
| Exact Mass | 270.09600 |
| PSA | 161.89000 |
| InChIKey | MDCTVRUPVLZSPG-BQBZGAKWSA-N |
| SMILES | NC(Cc1cnc[nH]1)C(=O)NC(CC(=O)O)C(=O)O |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xi |
|---|
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| (S)-2-((S)-2-Hydrazinyl-3-(1H-iMidazol-4-yl)propanaMido)propanoic acid |
| L-HISTIDYL-L-ALANINE |
| L-His-L-Ala |
| HIS-ALA |
| histidinoalanine |
| histidylalanine |
| N-histidyl-aspartic acid |
| L-HIS-ALA |
| N-L-HISTIDINE-L-ALANYL |
| histidylaspartic acid |
| H-His-Asp-OH |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of L-Histidyl-L-aspartic acid? |
| A: Molecular formula of L-Histidyl-L-aspartic acid is C10H14N4O5. |
| Q: What is the English name of L-Histidyl-L-aspartic acid? |
| A: The English name of L-Histidyl-L-aspartic acid is L-Histidyl-L-aspartic acid. |
| Q: What English synonyms does L-Histidyl-L-aspartic acid have? |
| A: English synonyms of L-Histidyl-L-aspartic acid: (S)-2-((S)-2-Hydrazinyl-3-(1H-iMidazol-4-yl)propanaMido)propanoic acid, L-HISTIDYL-L-ALANINE, L-His-L-Ala, HIS-ALA, histidinoalanine, histidylalanine, N-histidyl-aspartic acid, L-HIS-ALA, N-L-HISTIDINE-L-ALANYL, histidylaspartic acid, H-His-Asp-OH. |
| Q: What is the polar surface area (PSA) of L-Histidyl-L-aspartic acid? |
| A: Polar surface area (PSA) of L-Histidyl-L-aspartic acid is 161.89000. |
| Q: What are the uses of L-Histidyl-L-aspartic acid? |
| A: Main uses of L-Histidyl-L-aspartic acid: H-His-Asp-OH is adipeptide. |
| Q: What is the molecular weight of L-Histidyl-L-aspartic acid? |
| A: Molecular weight of L-Histidyl-L-aspartic acid is 270.24. |
| Q: What is the InChIKey of L-Histidyl-L-aspartic acid? |
| A: InChIKey of L-Histidyl-L-aspartic acid is MDCTVRUPVLZSPG-BQBZGAKWSA-N. |
| Q: What is the SMILES notation of L-Histidyl-L-aspartic acid? |
| A: SMILES notation of L-Histidyl-L-aspartic acid is NC(Cc1cnc[nH]1)C(=O)NC(CC(=O)O)C(=O)O. |
| Q: What is the CAS number of L-Histidyl-L-aspartic acid? |
| A: CAS number of L-Histidyl-L-aspartic acid is 41658-60-0. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |