5-(4-methoxyphenyl)-5-oxo-pentanoic acid structure
|
Common Name | 5-(4-methoxyphenyl)-5-oxo-pentanoic acid | ||
|---|---|---|---|---|
| CAS Number | 4609-10-3 | Molecular Weight | 222.23700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-(4-methoxyphenyl)-5-oxopentanoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H14O4 |
|---|---|
| Molecular Weight | 222.23700 |
| Exact Mass | 222.08900 |
| PSA | 63.60000 |
| LogP | 2.13280 |
| InChIKey | UAMMMFTXGWKQLG-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)CCCC(=O)O)cc1 |
| Storage condition | 2-8°C |
| HS Code | 2918990090 |
|---|
| Precursor 8 | |
|---|---|
| DownStream 6 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Name: Inhibition of human recombinant PDE4B2 using cAMP as substrate after 2 hrs by TR-FRET...
Source: ChEMBL
Target: cAMP-specific 3',5'-cyclic phosphodiesterase 4B
External Id: CHEMBL3871027
|
| 5-(4-methoxy-phenyl)-5-oxo-pentanoic acid |
| 4-(4-methoxybenzoyl)butyric acid |
| 5-(4-Methoxy-phenyl)-5-oxo-valeriansaeure |
| 4-(4-methoxybenzoyl)butanoic acid |
| 5-(4-methoxyphenyl)-5-oxovaleric acid |