4-Hydroxy-2-nitrobenzoic acid
4-Hydroxy-2-nitrobenzoic acid structure
|
Common Name | 4-Hydroxy-2-nitrobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 74230-08-3 | Molecular Weight | 183.118 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 414.0±40.0 °C at 760 mmHg | |
| Molecular Formula | C7H5NO5 | Melting Point | 230ºC (dec.) | |
| MSDS | N/A | Flash Point | 190.8±15.8 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-Hydroxy-2-nitrobenzoic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 414.0±40.0 °C at 760 mmHg |
| Melting Point | 230ºC (dec.) |
| Molecular Formula | C7H5NO5 |
| Molecular Weight | 183.118 |
| Flash Point | 190.8±15.8 °C |
| Exact Mass | 183.016769 |
| PSA | 103.35000 |
| LogP | 1.80 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.664 |
| InChIKey | FNDZIIJCKXGZJA-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(O)cc1[N+](=O)[O-] |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2918290000 |
|---|
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 4 | |
|---|---|
| DownStream 5 | |
CAS#:610-36-6
CAS#:33844-21-2
CAS#:244765-00-2
CAS#:610-30-0
CAS#:19013-10-6
CAS#:104356-27-6
CAS#:178758-50-4
CAS#:108605-70-5
CAS#:38160-63-3This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2918290000 |
|---|---|
| Summary | HS: 2918290000 other carboxylic acids with phenol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) VAT:17.0% MFN tariff:6.5% General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4-Hydroxy-2-nitrobenzoic acid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the boiling point of 4-Hydroxy-2-nitrobenzoic acid? |
| A: Boiling point of 4-Hydroxy-2-nitrobenzoic acid is 414.0±40.0 °C at 760 mmHg. |
| Q: What is the SMILES notation of 4-Hydroxy-2-nitrobenzoic acid? |
| A: SMILES notation of 4-Hydroxy-2-nitrobenzoic acid is O=C(O)c1ccc(O)cc1[N+](=O)[O-]. |
| Q: What is the polar surface area (PSA) of 4-Hydroxy-2-nitrobenzoic acid? |
| A: Polar surface area (PSA) of 4-Hydroxy-2-nitrobenzoic acid is 103.35000. |
| Q: What is the melting point of 4-Hydroxy-2-nitrobenzoic acid? |
| A: Melting point of 4-Hydroxy-2-nitrobenzoic acid is 230ºC (dec.). |
| Q: What English synonyms does 4-Hydroxy-2-nitrobenzoic acid have? |
| A: English synonyms of 4-Hydroxy-2-nitrobenzoic acid: 4-Hydroxy-2-nitrobenzoic acid. |
| Q: What are the downstream products of 4-Hydroxy-2-nitrobenzoic acid? |
| A: Related downstream products(CAS) of 4-Hydroxy-2-nitrobenzoic acid: 19013-10-6;104356-27-6;178758-50-4;108605-70-5;38160-63-3. |
| Q: What is the LogP of 4-Hydroxy-2-nitrobenzoic acid? |
| A: LogP of 4-Hydroxy-2-nitrobenzoic acid is 1.80. |
| Q: What are the upstream materials of 4-Hydroxy-2-nitrobenzoic acid? |
| A: Related upstream materials(CAS) of 4-Hydroxy-2-nitrobenzoic acid: 610-36-6;33844-21-2;244765-00-2;610-30-0. |
| Q: What is the molecular weight of 4-Hydroxy-2-nitrobenzoic acid? |
| A: Molecular weight of 4-Hydroxy-2-nitrobenzoic acid is 183.118. |
| Q: What is the English name of 4-Hydroxy-2-nitrobenzoic acid? |
| A: The English name of 4-Hydroxy-2-nitrobenzoic acid is 4-Hydroxy-2-nitrobenzoic acid. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |