4-Amino-2-nitrobenzoic acid structure
|
Common Name | 4-Amino-2-nitrobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 610-36-6 | Molecular Weight | 182.133 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 440.9±35.0 °C at 760 mmHg | |
| Molecular Formula | C7H6N2O4 | Melting Point | 239 °C | |
| MSDS | N/A | Flash Point | 220.4±25.9 °C | |
| Name | 4-Amino-2-nitrobenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 440.9±35.0 °C at 760 mmHg |
| Melting Point | 239 °C |
| Molecular Formula | C7H6N2O4 |
| Molecular Weight | 182.133 |
| Flash Point | 220.4±25.9 °C |
| Exact Mass | 182.032761 |
| PSA | 109.14000 |
| LogP | 1.20 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.682 |
| InChIKey | SAJYSJVBNGUWJK-UHFFFAOYSA-N |
| SMILES | Nc1ccc(C(=O)O)c([N+](=O)[O-])c1 |
| Hazard Codes | Xi,Xn |
|---|---|
| Risk Phrases | R36/37/38:Irritating to eyes, respiratory system and skin . R20/21/22:Harmful by inhalation, in contact with skin and if swallowed . |
| Safety Phrases | S37/39-S26 |
| WGK Germany | 3 |
| RTECS | AY4240000 |
| Precursor 10 | |
|---|---|
| DownStream 9 | |
| Benzoic acid, 4-amino-2-nitro- |
| 4-Amino-2-nitro-benzoesaeure |
| MFCD00189376 |
| 4-Amino-2-nitrobenzoic acid |
| 4-amino-2-nitro-benzoic acid |
| 2-Nitro-4-aminobenzoic acid |
| 4-amino-2-nitropbenzoic acid |