Methyl4-hydroxy-2-nitrobenzoate structure
|
Common Name | Methyl4-hydroxy-2-nitrobenzoate | ||
|---|---|---|---|---|
| CAS Number | 178758-50-4 | Molecular Weight | 197.14500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H7NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 4-hydroxy-2-nitrobenzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H7NO5 |
|---|---|
| Molecular Weight | 197.14500 |
| Exact Mass | 197.03200 |
| PSA | 92.35000 |
| LogP | 1.61020 |
| InChIKey | XLTVRPYIMBEWNP-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(O)cc1[N+](=O)[O-] |
| Storage condition | 2-8°C |
|
~85%
Methyl4-hydroxy... CAS#:178758-50-4 |
| Literature: WYETH Patent: US2005/70584 A1, 2005 ; Location in patent: Page/Page column 24 ; |
|
~%
Methyl4-hydroxy... CAS#:178758-50-4 |
| Literature: Drain et al. Journal of the Chemical Society, 1949 , p. 1498,1502 |
| 4-hydroxy-2-nitro-benzoic acid methyl ester |
| 4-Hydroxy-2-nitro-benzoesaeure-methylester |
| Benzoic acid,4-hydroxy-2-nitro-,methyl ester |