methyl 5-bromo-1H-pyrazolo[3,4-b]pyridine-3-carboxylate
![methyl 5-bromo-1H-pyrazolo[3,4-b]pyridine-3-carboxylate Structure](https://image.chemsrc.com/caspic/119/916325-84-3.png)
methyl 5-bromo-1H-pyrazolo[3,4-b]pyridine-3-carboxylate structure
|
Common Name | methyl 5-bromo-1H-pyrazolo[3,4-b]pyridine-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 916325-84-3 | Molecular Weight | 256.06 | |
| Density | 1.6g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C8H6BrN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | methyl 5-bromo-2H-pyrazolo[3,4-b]pyridine-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.6g/cm3 |
|---|---|
| Molecular Formula | C8H6BrN3O2 |
| Molecular Weight | 256.06 |
| Exact Mass | 254.96434 |
| PSA | 69.38000 |
| LogP | 0.95440 |
| Index of Refraction | 1.689 |
| InChIKey | NWAGLGKQKQZPHF-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C2C=C(C=NC2=NN1)Br |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~43%
methyl 5-bromo-... CAS#:916325-84-3 |
| Literature: JANSSEN PHARMACEUTICA, N.V. Patent: WO2006/130673 A1, 2006 ; Location in patent: Page/Page column 74 ; WO 2006/130673 A1 |
|
~%
methyl 5-bromo-... CAS#:916325-84-3 |
| Literature: US2013/296302 A1, ; Paragraph 0508 ; |
|
~%
methyl 5-bromo-... CAS#:916325-84-3 |
| Literature: WO2011/84486 A1, ; |
|
~%
methyl 5-bromo-... CAS#:916325-84-3 |
| Literature: WO2011/84486 A1, ; |
|
~%
methyl 5-bromo-... CAS#:916325-84-3 |
| Literature: WO2011/84486 A1, ; |
|
~%
methyl 5-bromo-... CAS#:916325-84-3 |
| Literature: WO2011/84486 A1, ; |
|
~%
methyl 5-bromo-... CAS#:916325-84-3 |
| Literature: WO2011/84486 A1, ; |
![Methyl 1H-Pyrazolo[3,4-B]Pyridine-3-Carboxylate structure](https://image.chemsrc.com/caspic/157/916325-83-2.png)
![5-bromo-1H-pyrazolo[3,4-b]pyridine-3-carboxylic acid structure](https://image.chemsrc.com/caspic/081/916325-85-4.png)
![3-Methyl-1H-pyrazolo[3,4-b]pyridine structure](https://image.chemsrc.com/caspic/435/116834-96-9.png)
![1H-pyrazolo[3,4-b]pyridine-3-carboxylic acid structure](https://image.chemsrc.com/caspic/450/116855-08-4.png)
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| c-8255 |
| qc-838 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of methyl 5-bromo-2H-pyrazolo[3,4-b]pyridine-3-carboxylate? |
| A: Molecular formula of methyl 5-bromo-2H-pyrazolo[3,4-b]pyridine-3-carboxylate is C8H6BrN3O2. |
| Q: What is the SMILES notation of methyl 5-bromo-2H-pyrazolo[3,4-b]pyridine-3-carboxylate? |
| A: SMILES notation of methyl 5-bromo-2H-pyrazolo[3,4-b]pyridine-3-carboxylate is COC(=O)C1=C2C=C(C=NC2=NN1)Br. |
| Q: What is the English name of methyl 5-bromo-2H-pyrazolo[3,4-b]pyridine-3-carboxylate? |
| A: The English name of methyl 5-bromo-2H-pyrazolo[3,4-b]pyridine-3-carboxylate is methyl 5-bromo-2H-pyrazolo[3,4-b]pyridine-3-carboxylate. |
| Q: What English synonyms does methyl 5-bromo-2H-pyrazolo[3,4-b]pyridine-3-carboxylate have? |
| A: English synonyms of methyl 5-bromo-2H-pyrazolo[3,4-b]pyridine-3-carboxylate: c-8255, qc-838. |
| Q: What is the polar surface area (PSA) of methyl 5-bromo-2H-pyrazolo[3,4-b]pyridine-3-carboxylate? |
| A: Polar surface area (PSA) of methyl 5-bromo-2H-pyrazolo[3,4-b]pyridine-3-carboxylate is 69.38000. |
| Q: What is the CAS number of methyl 5-bromo-2H-pyrazolo[3,4-b]pyridine-3-carboxylate? |
| A: CAS number of methyl 5-bromo-2H-pyrazolo[3,4-b]pyridine-3-carboxylate is 916325-84-3. |
| Q: What is the InChIKey of methyl 5-bromo-2H-pyrazolo[3,4-b]pyridine-3-carboxylate? |
| A: InChIKey of methyl 5-bromo-2H-pyrazolo[3,4-b]pyridine-3-carboxylate is NWAGLGKQKQZPHF-UHFFFAOYSA-N. |
| Q: What is the molecular weight of methyl 5-bromo-2H-pyrazolo[3,4-b]pyridine-3-carboxylate? |
| A: Molecular weight of methyl 5-bromo-2H-pyrazolo[3,4-b]pyridine-3-carboxylate is 256.06. |
| Q: What is the LogP of methyl 5-bromo-2H-pyrazolo[3,4-b]pyridine-3-carboxylate? |
| A: LogP of methyl 5-bromo-2H-pyrazolo[3,4-b]pyridine-3-carboxylate is 0.95440. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |