Somatostatin structure
|
Common Name | Somatostatin | ||
|---|---|---|---|---|
| CAS Number | 51110-01-1 | Molecular Weight | 1637.878 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 1970.9±65.0 °C at 760 mmHg | |
| Molecular Formula | C76H104N18O19S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 1145.7±34.3 °C | |
Use of SomatostatinSomatostatin is a tetradecapeptide which can suppress the growth hormone (GH) secretion and control the pituitary hormone secretion in human CNS. |
| Name | Somatostatin |
|---|---|
| Synonym | More Synonyms |
| Description | Somatostatin is a tetradecapeptide which can suppress the growth hormone (GH) secretion and control the pituitary hormone secretion in human CNS. |
|---|---|
| Related Catalog | |
| In Vitro | Somatostatin is a tetradecapeptide which can suppress the growth hormone (GH) secretion and control the pituitary hormone secretion in human CNS. Somatostatin has two biologically active forms: the predominant form is the 14 amino-acid long Somatostatin-14 while the more potent form is the amino-terminus extended Somatostatin-28. The biological roles of the two Somatostatin isoforms very strongly overlap and the relative proportions of Somatostatin-14 to Somatostatin-28 vary between different tissues. Somatostatin can reduce adhesion of carcinosarcoma cells to the blood vessels and thus attenuate the metastatic potential of these tumours. Somatostatin can also inhibit monocyte chemotactic migration[1]. |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 1970.9±65.0 °C at 760 mmHg |
| Molecular Formula | C76H104N18O19S2 |
| Molecular Weight | 1637.878 |
| Flash Point | 1145.7±34.3 °C |
| Exact Mass | 1636.716675 |
| PSA | 663.83000 |
| LogP | -4.25 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Index of Refraction | 1.670 |
| InChIKey | NHXLMOGPVYXJNR-UHFFFAOYSA-N |
| SMILES | CC(N)C(=O)NCC(=O)NC1CSSCC(C(=O)O)NC(=O)C(CO)NC(=O)C(C(C)O)NC(=O)C(Cc2ccccc2)NC(=O)C(C(C)O)NC(=O)C(CCCCN)NC(=O)C(Cc2c[nH]c3ccccc23)NC(=O)C(Cc2ccccc2)NC(=O)C(Cc2ccccc2)NC(=O)C(CC(N)=O)NC(=O)C(CCCCN)NC1=O |
| Water Solubility | H2O: 1 mg/mL |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| growth hormone inhibiting hormone |
| 15-28-Somatostatin-28 |
| Modustatina |
| SS-14 |
| EINECS 254-186-5 |
| L-Alanyl-N-[(4R,7S,10S,13S,16S,19S,22S,25S,28S,31S,34S,37R)-19,34-bis(4-aminobutyl)-31-(2-amino-2-oxoethyl)-13,25,28-tribenzyl-4-carboxy-10-[(1S)-1-hydroxyethyl]-16-(1-hydroxyethyl)-7-(hydroxymethyl)-22-(1H-indol-3-ylmethyl)-6,9,12,15,18,21,24,27,30,33,36-undecaoxo-1,2-dithia-5,8,11,14,17,20,23,26,29,32,35-undecaazacyclooctatriacontan-37-yl]glycinamide |
| Somatostatin Acetate |
| Somatofalk |
| Stilamin |
| GH-RIF |
| SRIF-A |
| somatotropin release inhibiting factor |
| L-Alanylglycyl-L-cysteinyl-L-lysyl-L-asparaginyl-L-phenylalanyl-L-phenylalanyl-L-tryptophyl-L-lysyl-L-threonyl-L-phenylalanyl-L-threonyl-L-seryl-L-cysteine Cyclic (3®14) Disulfide |
| SRIF |
| Somatostatin |
| Somatostatina |
| Aminopan |
| L-Alanyl-N-[(4R,7S,10S,13S,16S,19S,22S,25S,28S,31S,34S,37R)-19,34-bis(4-aminobutyl)-31-(2-amino-2-oxoethyl)-13,25,28-tribenzyl-4-carboxy-10,16-bis[(1R)-1-hydroxyethyl]-7-(hydroxymethyl)-22-(1H-indol-3-ylmethyl)-6,9,12,15,18,21,24,27,30,33,36-undecaoxo-1,2-dithia-5,8,11,14,17,20,23,26,29,32,35-undecaazacyclooctatriacontan-37-yl]glycinamide |
| Glycinamide, L-alanyl-N-[(4R,7S,10S,13S,16S,19S,22S,25S,28S,31S,34S,37R)-19,34-bis(4-aminobutyl)-31-(2-amino-2-oxoethyl)-4-carboxy-10,16-bis[(1R)-1-hydroxyethyl]-7-(hydroxymethyl)-22-(1H-indol-3-ylmethyl)-6,9,12,15,18,21,24,27,30,33,36-undecaoxo-13,25,28-tris(phenylmethyl)-1,2-dithia-5,8,11,14,17,20,23,26,29,32,35-undecaazacyclooctatriacont-37-yl]- |
| Glycinamide, L-alanyl-N-[(4R,7S,10S,13S,16S,19S,22S,25S,28S,31S,34S,37R)-19,34-bis(4-aminobutyl)-31-(2-amino-2-oxoethyl)-4-carboxy-10-[(1S)-1-hydroxyethyl]-16-(1-hydroxyethyl)-7-(hydroxymethyl)-22-(1H-indol-3-ylmethyl)-6,9,12,15,18,21,24,27,30,33,36-undecaoxo-13,25,28-tris(phenylmethyl)-1,2-dithia-5,8,11,14,17,20,23,26,29,32,35-undecaazacyclooctatriacont-37-yl]- |