Phenazopyridine hydrochloride structure
|
Common Name | Phenazopyridine hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 136-40-3 | Molecular Weight | 249.699 | |
| Density | N/A | Boiling Point | 442.3ºC at 760 mmHg | |
| Molecular Formula | C11H12ClN5 | Melting Point | 139°C | |
| MSDS | Chinese USA | Flash Point | 221.3ºC | |
| Symbol |
GHS07, GHS08 |
Signal Word | Warning | |
Use of Phenazopyridine hydrochloridePhenazopyridine Hcl is a chemical, which has a local analgesic effect, often used to alleviate the pain, irritation, discomfort, or urgency caused by urinary tract infections, surgery, or injury to the urinary tract. |
| Name | phenazopyridine hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Description | Phenazopyridine Hcl is a chemical, which has a local analgesic effect, often used to alleviate the pain, irritation, discomfort, or urgency caused by urinary tract infections, surgery, or injury to the urinary tract. |
|---|---|
| Related Catalog |
| Boiling Point | 442.3ºC at 760 mmHg |
|---|---|
| Melting Point | 139°C |
| Molecular Formula | C11H12ClN5 |
| Molecular Weight | 249.699 |
| Flash Point | 221.3ºC |
| Exact Mass | 249.078125 |
| PSA | 89.65000 |
| LogP | 4.62580 |
| Vapour Pressure | 5.66E-09mmHg at 25°C |
| InChIKey | QQBPIHBUCMDKFG-UHFFFAOYSA-N |
| SMILES | Cl.Nc1ccc(N=Nc2ccccc2)c(N)n1 |
| Storage condition | Amber Vial, -20°C Freezer |
| Water Solubility | 0.01-0.1 g/100 mL at 20 ºC |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
MUTATION DATA
|
| Symbol |
GHS07, GHS08 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H315-H319-H335-H351 |
| Precautionary Statements | P261-P281-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| Hazard Codes | Xn:Harmful; |
| Risk Phrases | R22;R36/37/38;R40 |
| Safety Phrases | S26-S36/37 |
| RIDADR | 2811 |
| RTECS | US7875000 |
| HS Code | 2933399090 |
|
~%
Phenazopyridine... CAS#:136-40-3 |
| Literature: Pharmazie, , vol. 35, # 2 p. 86 - 91 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Name: Primary qHTS assay for inhibitors of alpha-synuclein gene (SNCA) expression
Source: NCGC
External Id: SNCA-p-activity-luciferase
|
|
Name: Fluorescence-based cell-based primary high throughput screening assay to identify ago...
Source: The Scripps Research Institute Molecular Screening Center
Target: muscarinic acetylcholine receptor M1 [Homo sapiens]
External Id: CHRM1_AG_FLUO8_1536_1X%ACT PRUN
|
|
Name: Cytochrome P450 Family 1 Subfamily A Member 2 (CYP1A2) small molecule antagonists: lu...
Source: 824
External Id: CYP273
|
|
Name: Fluorescence-based cell-based primary high throughput screening assay to identify pos...
Source: The Scripps Research Institute Molecular Screening Center
Target: muscarinic acetylcholine receptor M1 [Homo sapiens]
External Id: CHRM1_PAM_FLUO8_1536_1X%ACT PRUN
|
|
Name: Drug activation in human Hep3B cells assessed as human CYP2C9-mediated drug metabolis...
Source: ChEMBL
Target: Cytochrome P450 2C9
External Id: CHEMBL4478999
|
|
Name: Drug activation in human Hep3B cells assessed as human CYP3A4-mediated drug metabolis...
Source: ChEMBL
Target: Cytochrome P450 3A4
External Id: CHEMBL4479056
|
|
Name: qHTS Assay for Small Molecule Inhibitors of the Human hERG Channel Activity
Source: NCGC
External Id: HERG01
|
|
Name: qHTS for Inhibitors of TGF-b: Cytotox Counterscreen
Source: NCGC
Target: N/A
External Id: SMAD3201
|
|
Name: uHTS identification of cystic fibrosis induced NFkb Inhibitors in a fluoresence assay
Source: Burnham Center for Chemical Genomics
Target: cystic fibrosis transmembrane conductance regulator [Homo sapiens]
External Id: SBCCG-A764-CF-PAF-Primary-Assay
|
|
Name: Fluorescence-based cell-based primary high throughput screening assay to identify ant...
Source: The Scripps Research Institute Molecular Screening Center
Target: muscarinic acetylcholine receptor M1 [Homo sapiens]
External Id: CHRM1_ANT_FLUO8_1536_1X%INH PRUN
|
| 2,6-diamino-3-phenylazopyridine hydrochloride |
| 3-Phenylazo-2,6-diaMinopyridine Monohydrochloride |
| Phenazopyridine HCl |
| phenazopyridine hydrochloride |
| Sedural |
| nc150 |
| EINECS 205-243-8 |
| 2,6-DIAMINO-3-(PHENYLAZO)-PYRIDINE HYDROCHLORIDE |
| giracid |
| MFCD00035347 |
| Pyridium |
| 3-phenyldiazenylpyridine-2,6-diamine monohydrochloride |
| azodyne |
| URODINE |
| 2,6-Pyridinediamine (3-[(1E)-2-phenyldiazenyl] |
| phenazopyridine monohydrochloride |
| 3-(Phenyldiazenyl)pyridine-2,6-diamine hydrochloride (1:1) |
| 2,6-Diamino-3-(phenylazo)pyridine hydrochloride,Urodine |
| uriplex |
| Prodium |
| pirid |
| pyrizin |
| 3-(Phenyldiazenyl)pyridine-2,6-diamine hydrochloride |
| urazium |
| Pyridacil |
| Phenazopyridine .HCl |
| dolonil |