N-((1R,2R)-2-Amino-1,2-diphenylethyl)-4-methylbenzenesulfonamide structure
|
Common Name | N-((1R,2R)-2-Amino-1,2-diphenylethyl)-4-methylbenzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 144222-34-4 | Molecular Weight | 366.48 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 537.3±60.0 °C at 760 mmHg | |
| Molecular Formula | C21H22N2O2S | Melting Point | 128-131 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 278.8±32.9 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of N-((1R,2R)-2-Amino-1,2-diphenylethyl)-4-methylbenzenesulfonamideTsDPEN is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
| Name | (R,R)-N-(p-Toluenesulfonyl)-1,2-diphenylethylenediamine |
|---|---|
| Synonym | More Synonyms |
| Description | TsDPEN is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
|---|---|
| Related Catalog |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 537.3±60.0 °C at 760 mmHg |
| Melting Point | 128-131 °C(lit.) |
| Molecular Formula | C21H22N2O2S |
| Molecular Weight | 366.48 |
| Flash Point | 278.8±32.9 °C |
| Exact Mass | 366.140198 |
| PSA | 80.57000 |
| LogP | 4.59 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.627 |
| InChIKey | UOPFIWYXBIHPIP-NHCUHLMSSA-N |
| SMILES | Cc1ccc(S(=O)(=O)NC(c2ccccc2)C(N)c2ccccc2)cc1 |
| Water Solubility | insoluble |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2935009090 |
|
~94%
N-((1R,2R)-2-Am... CAS#:144222-34-4 |
| Literature: Shankaraiah, Nagula; da Silva, Wender A.; Andrade, Carlos Kleber Z.; Santos, Leonardo Silva Tetrahedron Letters, 2008 , vol. 49, # 27 p. 4289 - 4291 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| (1R, 2R)-(-)-N-(4-Toluene sulfonyl)1,2-diphenyl-1,2-ethane diamine |
| (R,R)-N-(2-Amino-1,2-diphenylethyl)-p-toluenesulfonamide |
| (1R,2R)-(-)-N-(4-Toluene sulfonyl)1,2-diphenyl-1,2-ethane diamine |
| (1R,2R)-(-)-N-(4-Toluenesulfonyl)-1,2-diphenylethylenediamine |
| Benzenesulfonamide,N-[(1R,2R)-2-amino-1,2-diphenyl |
| Benzenesulfonamide, N-[(1R,2R)-2-amino-1,2-diphenylethyl]-4-methyl- |
| (R,R)-Tsdpen |
| (1R,2R)-(-)-N-(4-Toluenesulfonyl)-1,2- Diphenylethylenediamine |
| (1R,2R)-(-)-N-p-Tosyl-1,2-diphenylethylenediamine |
| (1R,2R)-(-)-N-(4-Toluenesulfonyl)-1,2-diphenylethylene-1,2-diamine |
| MFCD02093428 |
| N-[(1R,2R)-2-Amino-1,2-diphenylethyl]-4-methylbenzenesulfonamide |
| N-((1R,2R)-2-Amino-1,2-diphenylethyl)-4-methylbenzenesulfonamide |